| Company Name: |
Energy Chemical Gold |
| Tel: |
400-0056266 |
| Email: |
marketing1@energy-chemical.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
China Langchem Inc. |
| Tel: |
021-58956006,021-58950017 15800617331 |
| Email: |
sales@langchem.com |
Benzaldehyde-d6 manufacturers
- Benzaldehyde-d5
-
-
2025-04-04
- CAS:14132-51-5
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1Ton
|
| | Benzaldehyde-d6 Basic information |
| Product Name: | Benzaldehyde-d6 | | Synonyms: | BENZALDEHYDE-2,3,4,5,6-D5, 99 ATOM % D;2,3,4,5,6-pentadeuteriobenzaldehyde;Benzaldehyde-2,3,4,5,6-d5;2,3,4,5,6-D5-Benzaldehyde;Benzaldehyde (ring-D?, 98%) + 0.1% hydroquinone;BENZALDEHYDE-2,3,4,5,6-Dd5;Benzaldehyde-d6 | | CAS: | 14132-51-5 | | MF: | C7HD5O | | MW: | 111.15 | | EINECS: | | | Product Categories: | Alphabetical Listings;B;Stable Isotopes | | Mol File: | 14132-51-5.mol |  |
| | Benzaldehyde-d6 Chemical Properties |
| Melting point | -26 °C (lit.) | | Boiling point | 178-179 °C (lit.) | | density | 1.094 g/mL at 25 °C | | refractive index | n20/D 1.545(lit.) | | Fp | 145 °F | | solubility | Acetone (Sparingly), Acetonitrile (Slightly), Chloroform (Sparingly), Ethyl Acet | | form | Oil | | color | Colourless to Yellow | | Stability: | Air Sensitive, Hygroscopic | | InChI | InChI=1S/C7H6O/c8-6-7-4-2-1-3-5-7/h1-6H/i1D,2D,3D,4D,5D | | InChIKey | HUMNYLRZRPPJDN-RALIUCGRSA-N | | SMILES | C(C1C([2H])=C([2H])C([2H])=C([2H])C=1[2H])=O | | CAS Number Unlabeled | 100-52-7 |
| Hazard Codes | Xn | | Risk Statements | 22-42/43-40-36/37/38 | | Safety Statements | 24-36-26 | | RIDADR | UN 1990 9/PG 3 | | WGK Germany | 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 4 Inhalation
Acute Tox. 4 Oral
Aquatic Chronic 2
Eye Irrit. 2
Repr. 1B
Skin Irrit. 2
STOT SE 3 |
| | Benzaldehyde-d6 Usage And Synthesis |
| Uses | Benzaldehyde-d5 is a labelled analog of Benzaldehyde , which is mainly used as a precursor to other organic compounds, such as pharmaceuticals and plastic additives. Benzaldehyde-d5 can be used in the preparation of deuterium-labeled phenylalanine and synthesis of stable isotope-labeled nasturlexins and potential precursors to probe biosynthetic pathways of cruciferous phytoalexins. |
| | Benzaldehyde-d6 Preparation Products And Raw materials |
|