N-(3-amino-1-methylpropyl)-N,N-dimethylamine manufacturers
|
| | N-(3-amino-1-methylpropyl)-N,N-dimethylamine Basic information |
| Product Name: | N-(3-amino-1-methylpropyl)-N,N-dimethylamine | | Synonyms: | Albb-004082;(3-amino-1-methylpropyl)dimethylamine(SALTDATA: FREE);(3-amino-1-methylpropyl)dimethylamine;N-(3-amino-1-methylpropyl)-N,N-dimethylamine;N-(3-Amino-1-methylpropyl)dimethylamine;N3,N3-Dimethylbutane-1,3-diamine;(4-aminobutan-2-yl)dimethylamine;1,3-Butanediamine, N3,N3-dimethyl- | | CAS: | 60978-33-8 | | MF: | C6H16N2 | | MW: | 116.2 | | EINECS: | | | Product Categories: | | | Mol File: | 60978-33-8.mol |  |
| | N-(3-amino-1-methylpropyl)-N,N-dimethylamine Chemical Properties |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | form | liquid | | InChI | InChI=1S/C6H16N2/c1-6(4-5-7)8(2)3/h6H,4-5,7H2,1-3H3 | | InChIKey | HMNAAVUZNWPXDC-UHFFFAOYSA-N | | SMILES | C(N)CC(N(C)C)C |
| Hazard Codes | C | | Risk Statements | 21/22-34-43 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 2735PSN1 8 / PGII | | WGK Germany | 3 | | HazardClass | IRRITANT | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Acute Tox. 4 Dermal
Acute Tox. 4 Oral
Skin Corr. 1B
Skin Sens. 1 |
| | N-(3-amino-1-methylpropyl)-N,N-dimethylamine Usage And Synthesis |
| Uses | N-(3-Amino-1-methylpropyl)-N,N-dimethylamine is used in preparation of Dihydropyrazolecarboxamide derivatives useful for the treatment of cancer and fibrosis. |
| | N-(3-amino-1-methylpropyl)-N,N-dimethylamine Preparation Products And Raw materials |
|