|
|
| | 4-Hydroxy propofol Basic information |
| Product Name: | 4-Hydroxy propofol | | Synonyms: | 2,6-Bis(1-methylethyl)-1,4-benzenediol;2,6-Diisopropylhydroquinone;2,6-DI-ISOPROPYL-HYDROQUINOL;2,6-diisopropylbenzene-1,4-diol;2,6-di(propan-2-yl)benzene-1,4-diol;Propofol Impurity 20;1,4-Benzenediol, 2,6-bis(1-methylethyl)-;4-Hydroxy propofol | | CAS: | 1988-10-9 | | MF: | C12H18O2 | | MW: | 194.27 | | EINECS: | | | Product Categories: | Various Metabolites and Impurities;Intermediates & Fine Chemicals;Metabolites & Impurities;Pharmaceuticals | | Mol File: | 1988-10-9.mol |  |
| | 4-Hydroxy propofol Chemical Properties |
| Melting point | 103-105C | | Boiling point | 321.8±37.0 °C(Predicted) | | density | 1.042±0.06 g/cm3(Predicted) | | storage temp. | Refrigerator | | solubility | Chloroform (Slightly), Methanol (Slightly) | | pka | 10.83±0.23(Predicted) | | form | Solid | | color | Pale Pink to Pale Orange | | InChI | InChI=1S/C12H18O2/c1-7(2)10-5-9(13)6-11(8(3)4)12(10)14/h5-8,13-14H,1-4H3 | | InChIKey | UFWIJKBKROBWTG-UHFFFAOYSA-N | | SMILES | C1(O)=C(C(C)C)C=C(O)C=C1C(C)C |
| | 4-Hydroxy propofol Usage And Synthesis |
| Chemical Properties | Pale Pink Solid | | Uses | A metabolite of Propofol. | | Definition | ChEBI: 4-hydroxypropofol is a hydroquinone that is propofol which is substituted by a hydroxy group at position 4. It is a metabolite of the short acting anaesthetic drug, propofol. It has a role as a drug metabolite. It is functionally related to a propofol. |
| | 4-Hydroxy propofol Preparation Products And Raw materials |
|