| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Angelic acid methyl ester Basic information |
| Product Name: | Angelic acid methyl ester | | Synonyms: | 2-methyl-,methylester,(Z)-2-Butenoicacid;2-METHYLISOCROTONIC ACID METHYL ESTER;METHYL ANGELATE;(Z)-2-METHYL-2-BUTENOIC ACID METHYL ESTER;methyl 2-methylisocrotonate;METHYL (Z)-2-METHYLBUT-2-ENOATE;Methyl (Z)-2-Methyl-2-butenoate;(2Z)-2-Methyl-2-butenoic acid methyl ester | | CAS: | 5953-76-4 | | MF: | C6H10O2 | | MW: | 114.14 | | EINECS: | 227-718-9 | | Product Categories: | | | Mol File: | 5953-76-4.mol |  |
| | Angelic acid methyl ester Chemical Properties |
| Boiling point | 130 °C | | density | 0,95 g/cm3 | | refractive index | 1.4310-1.4340 | | storage temp. | 0-10°C | | solubility | soluble in Methanol | | form | clear liquid | | color | Colorless to Light yellow | | Odor | pungent ethereal | | InChI | InChI=1S/C6H10O2/c1-4-5(2)6(7)8-3/h4H,1-3H3/b5-4- | | InChIKey | YYJWBYNQJLBIGS-PLNGDYQASA-N | | SMILES | C(OC)(=O)/C(/C)=C\C | | LogP | 1.715 (est) |
| Risk Statements | 10 | | Safety Statements | 16 | | RIDADR | 3272 | | HazardClass | 3 | | PackingGroup | III | | HS Code | 2916199590 |
| | Angelic acid methyl ester Usage And Synthesis |
| Uses | Angelic Acid Methyl Ester is a reactant in the synthesis of natural (-)-Evoninic acid. |
| | Angelic acid methyl ester Preparation Products And Raw materials |
|