5-Methoxy-2-formylphenylboronic acid manufacturers
|
| | 5-Methoxy-2-formylphenylboronic acid Basic information |
| | 5-Methoxy-2-formylphenylboronic acid Chemical Properties |
| Melting point | 155-160 °C | | Boiling point | 418.0±55.0 °C(Predicted) | | density | 1.25±0.1 g/cm3(Predicted) | | storage temp. | Inert atmosphere,2-8°C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | pka | 7.75±0.53(Predicted) | | color | White to Off-White | | InChI | 1S/C8H9BO4/c1-13-7-3-2-6(5-10)8(4-7)9(11)12/h2-5,11-12H,1H3 | | InChIKey | YISYHZMNRATPRA-UHFFFAOYSA-N | | SMILES | O=C([H])C1=CC=C(OC)C=C1B(O)O | | CAS DataBase Reference | 40138-18-9(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 37/39-26 | | WGK Germany | WGK 3 | | HazardClass | IRRITANT, KEEP COLD | | HS Code | 29310099 | | Storage Class | 11 - Combustible Solids |
| Provider | Language |
|
ACROS
| English |
| | 5-Methoxy-2-formylphenylboronic acid Usage And Synthesis |
| Chemical Properties | Yellowish-beige powder | | Uses | suzuki reaction | | Uses | 5-Methoxy-2-formylphenylboronic acid is a reagent used in the total synthesis of laetevirenol A via intramolecular Friedel-Crafts alkylation. |
| | 5-Methoxy-2-formylphenylboronic acid Preparation Products And Raw materials |
|