| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | GLYCEROL-D8 Basic information |
| Product Name: | GLYCEROL-D8 | | Synonyms: | GLYCEROL (U-D8);GLYCEROL-D8;1,2,3-Propanetriol-d8;Glycerin-d8;GLYCEROL-D8, 98 ATOM% D, 98% CHEMICAL PURITY;1,2,3-Propane-1,1,2,3,3-d5-triol-d3;Deuterium glycerol - D8;1,1,2,3,3-pentadeuterio-1,2,3-trideuteriooxypropane | | CAS: | 7325-17-9 | | MF: | C3H8O3 | | MW: | 92.09 | | EINECS: | | | Product Categories: | Additional Labeled ProductsStable Isotopes;Minimal MediaStable Isotopes;NMR - Buffers and ReagentsMore...Close...;Alphabetical Listings;Biomolecular NMR;Buffers and ReagentsStable Isotopes;Fatty AcidsStable Isotopes;G-HStable Isotopes;Mass Spectrometry;Metabolic Research;NMR Solvents and Reagents;Proteomics Stable Isotope Labeling;Glycerol - 13C & 2H | | Mol File: | 7325-17-9.mol |  |
| | GLYCEROL-D8 Chemical Properties |
| Melting point | 20 °C(lit.) | | Boiling point | 182 °C(lit.) | | density | 1.371 g/mL at 25 °C | | refractive index | n20/D 1.466(lit.) | | Fp | >230 °F(lit.) | | storage temp. | Storage temp. -20°C | | solubility | Water (Soluble) | | form | Oil | | color | Colourless | | Stability: | Stable, but moisture sensitive. Incompatible with strong bases, strong oxidizing agents. | | InChI | 1S/C3H8O3/c4-1-3(6)2-5/h3-6H,1-2H2/i1D2,2D2,3D,4D,5D,6D | | InChIKey | PEDCQBHIVMGVHV-YHPVEMKJSA-N | | SMILES | [2H]OC([2H])([2H])C([2H])(O[2H])C([2H])([2H])O[2H] | | CAS Number Unlabeled | 56-81-5 |
| WGK Germany | 1 | | Storage Class | 10 - Combustible liquids |
| | GLYCEROL-D8 Usage And Synthesis |
| Chemical Properties | colourless viscous liquid | | Uses | Glycerol-d8 is the labelled form of Glycerol which is used both in sample preparation and gel formation for polyacrylamide gel electrophoresis. Glycerol (5-10%) increases the density of a sample so that the sample will layer at the bottom of a gel’s sample well. Glycerol is also used to aid in casting gradient gels and as a protein stabilizer and storage buffer component. |
| | GLYCEROL-D8 Preparation Products And Raw materials |
|