| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Sodium L-lactate-3,3,3-d3 Basic information |
| Product Name: | Sodium L-lactate-3,3,3-d3 | | Synonyms: | L-Lactic-3,3,3-d3 acid solution sodium salt;Sodium L-lactate-3,3,3-d3 solution;SODIUM L-LACTATE (3,3,3-D3, 98%) 20% W/W IN H2O;Sodium L-lactate-3,3,3-d3 solution;Sodium L-lactate (3,3,3-D?, 98%) 20% w/w in water;L-Lactate-d3 Sodium;L-Lactic acid-d3 (sodium);L-Lactic Acid-D3 Sodium (Standard) | | CAS: | 285979-84-2 | | MF: | C3H7NaO3 | | MW: | 114.08 | | EINECS: | | | Product Categories: | Isotope Labelled Compounds, Pharmaceuticals, Intermediates & Fine Chemicals | | Mol File: | 285979-84-2.mol |  |
| | Sodium L-lactate-3,3,3-d3 Chemical Properties |
| Melting point | 163-165 °C(lit.) | | storage temp. | -20°C | | solubility | DMSO (Slightly), Methanol (Slightly), Water (Slightly) | | form | Solid | | color | White to Off-White | | Stability: | Hygroscopic | | InChI | 1S/C3H6O3.Na/c1-2(4)3(5)6;/h2,4H,1H3,(H,5,6);/q;+1/p-1/t2-;/m0./s1/i1D3; | | InChIKey | NGSFWBMYFKHRBD-QQAVFRBQSA-M | | SMILES | [Na+].[2H]C([2H])([2H])[C@H](O)C([O-])=O | | CAS Number Unlabeled | 867-56-1 |
| WGK Germany | WGK 3 | | Storage Class | 10 - Combustible liquids |
| | Sodium L-lactate-3,3,3-d3 Usage And Synthesis |
| Uses | Labelled sodium salt of L-Lactic Acid. L-Lactic Acid occurs in small quantities in the blood and muscle fluid of man and animals. The lactic acid concentration increases in muscle and blood after vigorous activity. L-(+)-Lactic acid is also present in liver, kidney, thymus gland, human amniotic fluid, and other organs and body fluids. | | Uses | Labelled sodium salt of L-Lactic Acid (L113500). L-Lactic Acid occurs in small quantities in the blood and muscle fluid of man and animals. The lactic acid concentration increases in muscle and blood after vigorous activity. L-(+)-Lactic acid is also present in liver, kidney, thymus gland, human amniotic fluid, and other organs and body fluids. |
| | Sodium L-lactate-3,3,3-d3 Preparation Products And Raw materials |
|