| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 4-Methyl-1,10-phenanthroline Basic information |
| Product Name: | 4-Methyl-1,10-phenanthroline | | Synonyms: | 4-methyl-10-phenanthroline;TIMTEC-BB SBB009139;4-Methyl Phenanthroline;4-Methyl-1,10-phenanthroline 98%;1,10-Phenanthroline, 4-methyl-;4-Methyl-1,1-phenanthroline;4-Methyl-1,10-phenanthroline | | CAS: | 31301-28-7 | | MF: | C13H10N2 | | MW: | 194.23 | | EINECS: | 625-820-1 | | Product Categories: | | | Mol File: | 31301-28-7.mol |  |
| | 4-Methyl-1,10-phenanthroline Chemical Properties |
| Melting point | 143-145 °C(lit.) | | Boiling point | 381.2±22.0 °C(Predicted) | | density | 1.211±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | form | Crystalline | | pka | 5.49±0.10(Predicted) | | Water Solubility | Soluble in water. | | InChI | InChI=1S/C13H10N2/c1-9-6-8-15-13-11(9)5-4-10-3-2-7-14-12(10)13/h2-8H,1H3 | | InChIKey | NAZZKEZTSOOCSZ-UHFFFAOYSA-N | | SMILES | N1C2C(=CC=C3C=2N=CC=C3)C(C)=CC=1 | | EPA Substance Registry System | 1,10-Phenanthroline, 4-methyl- (31301-28-7) |
| Hazard Codes | Xn,Xi | | Risk Statements | 22-36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | TSCA | TSCA listed | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 4-Methyl-1,10-phenanthroline Usage And Synthesis |
| Uses | 4-methyl-1,10-phenanthroline can be used to produce 1,10-Phenanthrolin-4-aldehyde. | | General Description | 4-Methyl-1,10-phenanthroline (4-Mephen) is a methyl substituted phenanthroline commonly used as a ligand. |
| | 4-Methyl-1,10-phenanthroline Preparation Products And Raw materials |
|