|
|
| | 2-Methylisonicotinic acid Basic information |
| | 2-Methylisonicotinic acid Chemical Properties |
| Melting point | 295-299 °C (D) | | Boiling point | 368.2±22.0 °C(Predicted) | | density | 1.230±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | form | powder to crystal | | pka | 2.02±0.10(Predicted) | | color | White to Almost white | | InChI | InChI=1S/C7H7NO2/c1-5-4-6(7(9)10)2-3-8-5/h2-4H,1H3,(H,9,10) | | InChIKey | PMDHIMMPXRSDML-UHFFFAOYSA-N | | SMILES | C1(C)=NC=CC(C(O)=O)=C1 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37 | | WGK Germany | 3 | | HS Code | 29333990 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 2-Methylisonicotinic acid Usage And Synthesis |
| Chemical Properties | White to light brown solid | | Uses | 2-Methylpyridine-4-carboxylic acid is an important raw material and intermediate used in pharmaceuticals, agrochemicals and dyestuff. | | Properties and Applications | 2-Methylisonicotinic acid serves as a key building block in proteomics research and the preparation of pyridine-based derivatives. Its functional groups (carboxylic acid, pyridine nitrogen, and methyl group) provide multiple sites for chemical modifications, making it versatile in organic synthesis. |
| | 2-Methylisonicotinic acid Preparation Products And Raw materials |
|