- 2,3-Difluoroaniline
-
- $10.50
-
2026-05-28
- CAS:4519-40-8
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 10 ton
|
| | 2,3-Difluoroaniline Basic information |
| Product Name: | 2,3-Difluoroaniline | | Synonyms: | 2,3-DIFLUOROANILINE;2,3-Difluorobenzenamine;TIMTEC-BB SBB006565;2,3-Difluoroaniline 98%;2,3-Difluoroaniline,98%;2,3-difluorophenylamine;Benzenamine, 2,3-difluoro-;2,3-Difluoroaniline, 98% 1GR | | CAS: | 4519-40-8 | | MF: | C6H5F2N | | MW: | 129.11 | | EINECS: | 224-847-2 | | Product Categories: | Fluorobenzene Series;Other fluorin-contained compounds;Anilines, Aromatic Amines and Nitro Compounds;Aniline;Miscellaneous;Amines;C2 to C6;Nitrogen Compounds;Fluorobenzene;Amines and Anilines | | Mol File: | 4519-40-8.mol |  |
| | 2,3-Difluoroaniline Chemical Properties |
| Boiling point | 68-69 °C | | density | 1.274 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.514(lit.) | | Fp | 160 °F | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | pka | 2.19±0.10(Predicted) | | form | Liquid | | Specific Gravity | 1.274 | | color | Clear light orange | | BRN | 2716500 | | InChI | InChI=1S/C6H5F2N/c7-4-2-1-3-5(9)6(4)8/h1-3H,9H2 | | InChIKey | YCCQGFYAVUTQFK-UHFFFAOYSA-N | | SMILES | C1(N)=CC=CC(F)=C1F | | CAS DataBase Reference | 4519-40-8(CAS DataBase Reference) |
| Hazard Codes | Xn,Xi | | Risk Statements | 20/21/22-36/37/38 | | Safety Statements | 26-27-28-36/37/39-36 | | RIDADR | 2941 | | WGK Germany | 3 | | Hazard Note | Irritant | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 29214200 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Acute Tox. 4 Dermal
Acute Tox. 4 Inhalation
Acute Tox. 4 Oral
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 2,3-Difluoroaniline Usage And Synthesis |
| Chemical Properties | clear light orange liquid | | Uses | 2,3-Difluoroaniline was used in the synthesis of ethyl 2-arylamino-4-trifluoromethylpyrimidine-5-carboxylate. | | Uses | intermediate for liquid crystal and drugs | | Synthesis | The general procedure for the synthesis of 2,3-difluoroaniline from 2,3-dibromo-5,6-difluoronitrobenzene was as follows: first, 0.638 g (2.01 mmol) of 2,3-dibromo-5,6-difluoronitrobenzene was dissolved in 4 mL of methanol. Subsequently, 48.4 mg of 10% Pd/C (50% wet) catalyst and 6.2 mg (0.06 mmol) of triethylamine were added to the solution. The atmosphere in the reaction vessel was replaced with hydrogen and the reaction mixture was stirred at 50 °C for 2 h under slight hydrogen pressure. The reaction mixture was analyzed by HPLC, which showed the presence of 2.2 area% of 2,3-dibromo-5,6-difluoroaniline as a residual intermediate. The reaction was continued under the same conditions for 0.5 hours. After completion of the reaction, the catalyst was removed by filtration. The resulting liquid was quantitatively analyzed by HPLC and the yield of 2,3-difluoroaniline was measured to be 93% and the intermediate 2,3-dibromo-5,6-difluoroaniline was completely consumed. | | References | [1] Patent: EP2940002, 2015, A1. Location in patent: Paragraph 0075 |
| | 2,3-Difluoroaniline Preparation Products And Raw materials |
|