MONOPALMITOLEIN manufacturers
|
| | MONOPALMITOLEIN Basic information |
| Product Name: | MONOPALMITOLEIN | | Synonyms: | 1-Mono(cis-9-hexadecenoyl)-rac-glycerol, Glyceryl 9-hexadecenoate, Monopalmitolein;1-Monopalmitoleoyl-rac-glycerol,1-Mono(cis-9-hexadecenoyl)-rac-glycerol, Glyceryl 9-hexadecenoate, Monopalmitolein;(Z)-2,3-dihydroxypropyl hexadec-9-enoate;LCP 16;MONOPALMITOLEIN;1-MONOPALMITOLEIN;1-MONOPALMITOLEOYL-RAC-GLYCEROL;1-MONO[CIS-9-HEXADECENOYL]-RAC-GLYCEROL | | CAS: | 37515-61-0 | | MF: | C19H36O4 | | MW: | 328.49 | | EINECS: | | | Product Categories: | | | Mol File: | 37515-61-0.mol |  |
| | MONOPALMITOLEIN Chemical Properties |
| Boiling point | 458.2±35.0 °C(Predicted) | | density | 0.981±0.06 g/cm3(Predicted) | | storage temp. | −20°C | | solubility | DMF: 20 mg/ml; DMSO: 5 mg/ml; Ethanol: 30 mg/ml; PBS (pH 7.2): 0.25 mg/ml | | form | low-melting solid | | pka | 13.16±0.20(Predicted) | | color | Colorless to off-white | | InChI | 1S/C19H36O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-19(22)23-17-18(21)16-20/h7-8,18,20-21H,2-6,9-17H2,1H3/b8-7- | | InChIKey | KVYUBFKSKZWZSV-FPLPWBNLSA-N | | SMILES | CCCCCC/C=C\CCCCCCCC(OCC(O)CO)=O |
| WGK Germany | 3 | | Storage Class | 10 - Combustible liquids |
| | MONOPALMITOLEIN Usage And Synthesis |
| Uses | 1-Monopalmitolein is a component of bitter melons with possible inhibitory effect on the P-glycoprotein activity in intestinal Caco-2 cells. It may also be used as an apoptotic agent in T-cells. | | Definition | ChEBI: 1-[(9Z)-hexadecenoyl]glycerol is a 1-monoglyceride in which the acyl group is specified as (9Z)-hexadecenoyl. It is functionally related to a palmitoleic acid. | | Biological Activity | Monopalmitolein is used in comparative studies of the antimicrobial activity of monoglycerides such as monocaprin, and monlaurin. |
| | MONOPALMITOLEIN Preparation Products And Raw materials |
|