|
|
| | Perfluorooctanesulfonamide Basic information |
| Product Name: | Perfluorooctanesulfonamide | | Synonyms: | PERFLUOROOCTANSULFONAMIDE;N-Ethyl-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluoro-1- octanesulfonamide;heptadecafluorooctanesulphonamide;PERFLUOROOCCTANESULFONAMIDE;Perfluoroalkylsulfoamide;Perfluorooctanesulfonamide ,90%;1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-Heptadecafluorooctane-1-sulfonamide;Heptadecafluorooctylsulfonylamine | | CAS: | 754-91-6 | | MF: | C8H2F17NO2S | | MW: | 499.14 | | EINECS: | 212-046-0 | | Product Categories: | | | Mol File: | 754-91-6.mol |  |
| | Perfluorooctanesulfonamide Chemical Properties |
| Melting point | 151-152 °C | | Boiling point | 227.2±50.0 °C(Predicted) | | density | 1.7595 (estimate) | | storage temp. | 2-8°C | | solubility | Acetone (Slightly), Methanol (Sparingly) | | form | Solid | | pka | 7.01±0.60(Predicted) | | color | Off-White | | Henry's Law Constant | 5.5×10-6 mol/(m3Pa) at 25℃, HSDB (2015) | | InChI | 1S/C8H2F17NO2S/c9-1(10,3(13,14)5(17,18)7(21,22)23)2(11,12)4(15,16)6(19,20)8(24,25)29(26,27)28/h(H2,26,27,28) | | InChIKey | RRRXPPIDPYTNJG-UHFFFAOYSA-N | | SMILES | NS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F | | CAS DataBase Reference | 754-91-6(CAS DataBase Reference) | | EPA Substance Registry System | Perfluorooctanesulfonamide (754-91-6) |
| Hazard Codes | Xi | | Risk Statements | 53 | | Safety Statements | 22-24/25 | | WGK Germany | WGK 3 | | Hazard Note | Irritant | | HS Code | 29241990 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 4 Inhalation
Acute Tox. 4 Oral
Aquatic Chronic 2
Carc. 2
Lact.
Repr. 1B
STOT RE 1 | | Hazardous Substances Data | 754-91-6(Hazardous Substances Data) | | Toxicity | LD50 orl-rat: >172 mg/kg ATDAEI 15(Suppl 1),S104,1996 |
| | Perfluorooctanesulfonamide Usage And Synthesis |
| Chemical Properties | White to off-white solid | | Uses | Perfluorooctanesulfonamide is a longer chain fluorinated surfactant used in polymers. Used in aqueous film firm-forming foam to extinguish hydrocarbon-based fires. | | Definition | ChEBI: Perfluorooctanesulfonamide is a perfluorinated compound that is perfluorooctane in which one of the terminal fluorines has been replace by a sulfamoyl group. It has a role as a persistent organic pollutant. It is a sulfonamide and a perfluorinated compound. | | Safety Profile | A poison by ingestion.When heated to decomposition it emits toxic vapors of SOx, NOx, and Fí. |
| | Perfluorooctanesulfonamide Preparation Products And Raw materials |
|