- Boc-Glu(OcHx)-OH
-
- $1.00 / 1g
-
2020-01-06
- CAS:73821-97-3
- Min. Order: 1g
- Purity: 98%
- Supply Ability: 100KG
|
| | Boc-L-glutamic acid 5-cyclohexyl ester Basic information |
| | Boc-L-glutamic acid 5-cyclohexyl ester Chemical Properties |
| Melting point | 54-57 °C | | Boiling point | 502.6±45.0 °C(Predicted) | | density | 1.16±0.1 g/cm3(Predicted) | | storage temp. | Sealed in dry,2-8°C | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | pka | 3.79±0.10(Predicted) | | form | Solid | | color | White to Almost white | | Optical Rotation | -7.5° (C=0.01 g/100ml, ACOH) | | Major Application | peptide synthesis | | InChI | 1S/C16H27NO6/c1-16(2,3)23-15(21)17-12(14(19)20)9-10-13(18)22-11-7-5-4-6-8-11/h11-12H,4-10H2,1-3H3,(H,17,21)(H,19,20)/t12-/m0/s1 | | InChIKey | FDNMLANBNJDIRG-LBPRGKRZSA-N | | SMILES | N([C@@H](CCC(=O)OC1CCCCC1)C(=O)O)C(=O)OC(C)(C)C | | CAS DataBase Reference | 73821-97-3(CAS DataBase Reference) |
| WGK Germany | 3 | | HS Code | 2924 29 70 | | Storage Class | 11 - Combustible Solids |
| | Boc-L-glutamic acid 5-cyclohexyl ester Usage And Synthesis |
| Chemical Properties | White to off-white powder | | Uses | This side-chain protecting group for glutamic acid, Boc-L-glutamic acid 5-cyclohexyl ester is used to minimize side reactions during acidic and basic treatments | | reaction suitability | reaction type: Boc solid-phase peptide synthesis |
| | Boc-L-glutamic acid 5-cyclohexyl ester Preparation Products And Raw materials |
|