|
|
| | 3-Amino-4-methylpyridine Chemical Properties |
| Melting point | 102-107 °C | | Boiling point | 254°C | | density | 1.0275 (estimate) | | refractive index | 1.5560 (estimate) | | Fp | 254°C | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | Chloroform, Ethyl Acetate, Methanol | | pka | 6.83±0.18(Predicted) | | form | powder to crystal | | color | White to Brown | | Sensitive | Hygroscopic | | BRN | 107792 | | InChI | InChI=1S/C6H8N2/c1-5-2-3-8-4-6(5)7/h2-4H,7H2,1H3 | | InChIKey | IBKMZYWDWWIWEL-UHFFFAOYSA-N | | SMILES | C1=NC=CC(C)=C1N | | CAS DataBase Reference | 3430-27-1(CAS DataBase Reference) | | NIST Chemistry Reference | 3-Pyridinamine, 4-methyl-(3430-27-1) |
| Hazard Codes | T,Xn | | Risk Statements | 23/24/25-36/37/38-41-37/38-22-20/21/22 | | Safety Statements | 26-36/37/39-45-36 | | RIDADR | 2811 | | WGK Germany | 3 | | Hazard Note | Toxic | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 29333990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Dam. 1
Skin Irrit. 2
STOT SE 3 |
| Provider | Language |
|
ALFA
| English |
| | 3-Amino-4-methylpyridine Usage And Synthesis |
| Application | 3-Amino-4-methylpyridine is an important pharmaceutical and chemical intermediate, widely used in the synthesis and research and development of pharmaceuticals, pesticides, and veterinary drugs, and has high application and market value. | | Chemical Properties | White to brown crystal or powder | | Definition | 3-amido-4-methylpyridine could synthesize 2-chlorin-3-amido-4-methyl pyridine through chlorination, the key intermediate of synthesizing anti-AIDS pharmaceutical nevirapine. | | Synthesis | 3-Amino-4-methylpyridine could be synthesized through the reaction of 4-methylpyridine and N2O5. | | References | [1] Patent: EP1428824, 2004, A1. Location in patent: Page 42
[2] Tetrahedron Letters, 2010, vol. 51, # 5, p. 786 - 789
[3] Journal of Heterocyclic Chemistry, 2001, vol. 38, # 1, p. 99 - 104
[4] Bulletin de la Societe Chimique de France, 1992, # 1, p. 79 - 84
[5] Chemische Berichte, 1927, vol. 60, p. 2108 |
| | 3-Amino-4-methylpyridine Preparation Products And Raw materials |
|