| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
2,4,6-Trifluorobenzyl bromide manufacturers
|
| | 2,4,6-Trifluorobenzyl bromide Basic information |
| Product Name: | 2,4,6-Trifluorobenzyl bromide | | Synonyms: | alpha-Bromo-2,4,6-trifluorotoluene;à-bromo-2,4,6-trifluorotoluene;2,4,6-Trifluorobenzyl bromide 97%;2,4,6-Trifluorobenzylbromide97%;Benzene, 2-(bromomethyl)-1,3,5-trifluoro-;2-(BROMOMETHYL)-1,3,5-TRIFLUOROBENZENE;2,4,6-Trifluorobenzyl bromide | | CAS: | 151411-98-2 | | MF: | C7H4BrF3 | | MW: | 225.01 | | EINECS: | | | Product Categories: | Aromatic Halides (substituted);Fluorine series | | Mol File: | 151411-98-2.mol |  |
| | 2,4,6-Trifluorobenzyl bromide Chemical Properties |
| Boiling point | 177.4±35.0 °C(Predicted) | | density | 1.710±0.06 g/cm3(Predicted) | | refractive index | 1.502 | | storage temp. | Storage temp. 2-8°C | | form | liquid | | color | Pale yellow | | Sensitive | Lachrymatory | | BRN | 8763072 | | InChI | InChI=1S/C7H4BrF3/c8-3-5-6(10)1-4(9)2-7(5)11/h1-2H,3H2 | | InChIKey | SPPLWANVCVTGEQ-UHFFFAOYSA-N | | SMILES | C1(F)=CC(F)=CC(F)=C1CBr | | CAS DataBase Reference | 151411-98-2(CAS DataBase Reference) |
| Hazard Codes | C,T | | Risk Statements | 34-36-25 | | Safety Statements | 26-36/37/39-45 | | RIDADR | 1760 | | WGK Germany | WGK 3 | | Hazard Note | Corrosive/Lachrymatory | | TSCA | T | | HazardClass | 8 | | PackingGroup | II | | HS Code | 2903998090 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral
Eye Dam. 1
Skin Corr. 1B |
| Provider | Language |
|
ALFA
| English |
| | 2,4,6-Trifluorobenzyl bromide Usage And Synthesis |
| | 2,4,6-Trifluorobenzyl bromide Preparation Products And Raw materials |
|