| Company Name: |
Shangfluoro Gold |
| Tel: |
021-65170832 15601903708 |
| Email: |
qinba_2@163.com |
|
| | 2,2-Difluoroethyl Acetate Basic information |
| Product Name: | 2,2-Difluoroethyl Acetate | | Synonyms: | 2,2-DIFLUOROETHYL ACETATE;2,2-Difluoroethyl acetate 97%;2,2-Difluoroethylacetate97%;2,2-difluoroethyl ethanoate;acetic acid 2,2-difluoroethyl ester;Ethanol, 2,2-difluoro-, 1-acetate;Acetatic Acid 2,2-Difluoroethyl Ester;2,2-difluroethyl acetate | | CAS: | 1550-44-3 | | MF: | C4H6F2O2 | | MW: | 124.09 | | EINECS: | 801-773-4 | | Product Categories: | | | Mol File: | 1550-44-3.mol |  |
| | 2,2-Difluoroethyl Acetate Chemical Properties |
| Boiling point | 105°C | | density | 1,203 g/cm3 | | vapor pressure | 68hPa at 25℃ | | refractive index | 1.352 | | Fp | 22°C | | storage temp. | 2-8°C, stored under nitrogen | | form | Liquid | | color | Colorless to Almost colorless | | Specific Gravity | 1.21 | | InChI | InChI=1S/C4H6F2O2/c1-3(7)8-2-4(5)6/h4H,2H2,1H3 | | InChIKey | PFJLHSIZFYNAHH-UHFFFAOYSA-N | | SMILES | C(OC(=O)C)C(F)F | | LogP | 0.45 at 20℃ and pH7.3-7.6 | | Surface tension | 70.5mN/m at 1g/L and 20℃ | | CAS DataBase Reference | 1550-44-3(CAS DataBase Reference) |
| Hazard Codes | F | | Risk Statements | 10-36/37/38 | | Safety Statements | 26-36/37/39 | | RIDADR | 3272 | | TSCA | TSCA listed | | HazardClass | FLAMMABLE | | PackingGroup | II | | HS Code | 2915390090 |
| | 2,2-Difluoroethyl Acetate Usage And Synthesis |
| Description |
2,2-Difluoroethyl Acetate is a fluorinated acyclic carboxylic acid ester. It could be prepared by reacting potassium acetate with HCF2CH2 Br. It is an essential component for the synthesis of active pharmaceutical ingredients (APIs) in medications aimed at different therapeutic areas. Furthermore, it functions as a precursor to insecticides and herbicides in agrochemical formulations.
|
| | 2,2-Difluoroethyl Acetate Preparation Products And Raw materials |
|