| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
6-Methylquinolin-2(1H)-one manufacturers
|
| | 6-Methylquinolin-2(1H)-one Basic information |
| Product Name: | 6-Methylquinolin-2(1H)-one | | Synonyms: | 2-Hydroxy-6-methylquinoline;6-Methyl-quinolin-2-ol;1,2-dihydro-6-Methylquinolin-2-one;6-methyl-2(1H)-Quinolinone;2(1H)-Quinolinone, 6-methyl-;6-Methylquinolin-2(1H)-one | | CAS: | 4053-34-3 | | MF: | C10H9NO | | MW: | 159.18 | | EINECS: | | | Product Categories: | | | Mol File: | 4053-34-3.mol |  |
| | 6-Methylquinolin-2(1H)-one Chemical Properties |
| Melting point | 237°C | | Boiling point | 284.68°C (rough estimate) | | density | 1.1202 (rough estimate) | | refractive index | 1.6070 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | pka | 11.81±0.70(Predicted) | | Appearance | Off-white to pink Solid | | InChI | InChI=1S/C10H9NO/c1-7-2-4-9-8(6-7)3-5-10(12)11-9/h2-6H,1H3,(H,11,12) | | InChIKey | LOUXUHOSYWFSHV-UHFFFAOYSA-N | | SMILES | N1C2=C(C=C(C)C=C2)C=CC1=O |
| | 6-Methylquinolin-2(1H)-one Usage And Synthesis |
| Synthesis Reference(s) | Journal of the American Chemical Society, 100, p. 7600, 1978 DOI: 10.1021/ja00492a028 |
| | 6-Methylquinolin-2(1H)-one Preparation Products And Raw materials |
|