|
| 6-Chloro-4-methylpyridazin-3-amine Basic information |
| 6-Chloro-4-methylpyridazin-3-amine Chemical Properties |
Melting point | 137 °C | Boiling point | 360.2±37.0 °C(Predicted) | density | 1.349±0.06 g/cm3(Predicted) | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | pka | 4.49±0.10(Predicted) | InChI | InChI=1S/C5H6ClN3/c1-3-2-4(6)8-9-5(3)7/h2H,1H3,(H2,7,9) | InChIKey | HSAHCMOZFNSMLH-UHFFFAOYSA-N | SMILES | C1(N)=NN=C(Cl)C=C1C |
| 6-Chloro-4-methylpyridazin-3-amine Usage And Synthesis |
Uses | 6-Chloro-4-methylpyridazin-3-amine is a reagent used in organic synthesis transformations. |
| 6-Chloro-4-methylpyridazin-3-amine Preparation Products And Raw materials |
|