- ML365
-
- $44.00 / 5mg
-
2026-04-20
- CAS:947914-18-3
- Min. Order:
- Purity: 99.91%
- Supply Ability: 10g
- ML365
-
- $1.00 / 1g
-
2019-12-24
- CAS:947914-18-3
- Min. Order: 1g
- Purity: 99%
- Supply Ability: 20kg
|
| Product Name: | ML365 | | Synonyms: | ML365;2-methoxy-N-(3-(3-methylbenzamido)phenyl)benzamide;ML-365; ML365; ML 365;2-methoxy-N-[3-[(3-methylbenzoyl)amino]phenyl]benzamide;CS-2437;Benzamide, 2-methoxy-N-[3-[(3-methylbenzoyl)amino]phenyl]-;KcsA,aldosterone,diseases,Inhibitor,autoimmune,channels,ML365,secretion,TASK,ML-365,potassium,Potassium Channel,TWIK-related,pharmacological,acid-sensitive,hypertension,inhibit,ML 365,CNS,tool;ML365, 10 mM in DMSO | | CAS: | 947914-18-3 | | MF: | C22H20N2O3 | | MW: | 360.41 | | EINECS: | | | Product Categories: | API | | Mol File: | 947914-18-3.mol |  |
| | ML365 Chemical Properties |
| Boiling point | 429.9±40.0 °C(Predicted) | | density | 1.253±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | DMSO:72.0(Max Conc. mg/mL);199.77(Max Conc. mM) Ethanol:18.0(Max Conc. mg/mL);49.94(Max Conc. mM) | | form | Powder | | pka | 13.21±0.70(Predicted) | | color | White to off-white | | InChI | 1S/C22H20N2O3/c1-15-7-5-8-16(13-15)21(25)23-17-9-6-10-18(14-17)24-22(26)19-11-3-4-12-20(19)27-2/h3-14H,1-2H3,(H,23,25)(H,24,26) | | InChIKey | UTAJHKSGYJSZBR-UHFFFAOYSA-N | | SMILES | N(c2cc(ccc2)NC(=O)c3cc(ccc3)C)C(=O)c1c(cccc1)OC |
| WGK Germany | WGK 3 | | Storage Class | 13 - Non Combustible Solids |
| | ML365 Usage And Synthesis |
| Uses | ML 365 acts as a potent and selective ASK-1 potassium channel blocker used in the regulation of cell membrane potential. This activity further modulates cell immune response, hormone changes, and neuronal function leading to various applications. | | Biological Activity | Orignially characterized as an mGluR5 negative allosteric modulator (IC50 = 1.35 μM, Emax = 3.82% of Glu Emax; r at mGluR5 HEK293A cells), ML365 is now better known as selective two-pore potassium (K2P) channel TASK1 (K2P3.1; KCNK3) inhibitor with 100- and 62-fold selectivity over TASK3 (K2p9.1; KCNK9), respectively, by thellium flux (r at TASK1/TASK3 CHO cell IC50 = 4/390 nM) and QPatch assay (r at TASK1/TASK3 CHO cell IC50 = 16/990 nM). ML365 is employed in the range from 40 nM to 20 μM. Selective TASK1 blockage is achieved at the lower end of the concentration range, while TASK3 activity can also be inhibited at the high end of the range. | | storage | Store at +4°C |
| | ML365 Preparation Products And Raw materials |
|