|
|
| | 2,3-Dichloro-6-nitrobenzonitrile Basic information |
| | 2,3-Dichloro-6-nitrobenzonitrile Chemical Properties |
| Melting point | 93-96 °C(lit.) | | Boiling point | 343.7±42.0 °C(Predicted) | | density | 1.61±0.1 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) | | form | Solid | | color | Beige | | InChI | 1S/C7H2Cl2N2O2/c8-5-1-2-6(11(12)13)4(3-10)7(5)9/h1-2H | | InChIKey | RDFDRMZYAXQLRT-UHFFFAOYSA-N | | SMILES | [O-][N+](=O)c1ccc(Cl)c(Cl)c1C#N | | CAS DataBase Reference | 2112-22-3(CAS DataBase Reference) |
| Hazard Codes | Xi | | WGK Germany | 3 | | Hazard Note | Irritant | | HS Code | 2926907090 | | Storage Class | 11 - Combustible Solids |
| | 2,3-Dichloro-6-nitrobenzonitrile Usage And Synthesis |
| Chemical Properties | Brown Solid | | Uses | Anagrelide intermediate. | | Uses | 2,3-Dichloro-6-nitrobenzonitrile may be employed as a starting reagent for the synthesis of ethyl (2-amino-5,6-dichlorobenzyl)glycinate. | | General Description | 2,3-Dichloro-6-nitrobenzonitrile can be synthesized from 4-nitro-1,2,3-trichlorobenzene. It is formed as an intermediate during the synthesis of anagrelide. |
| | 2,3-Dichloro-6-nitrobenzonitrile Preparation Products And Raw materials |
|