| Company Name: |
T&W GROUP |
| Tel: |
021-61551611 13296011611 |
| Email: |
contact@trustwe.com |
- Amino-PEG4-CH2COOH
-
- $2.00
-
2026-08-25
- CAS:195071-49-9
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 100kg
- NH2-PEG4-CH2COOH
-
-
2026-01-29
- CAS:195071-49-9
- Min. Order: 1g
- Purity: 98%
- Supply Ability: 300kg
|
| | Amino-PEG4-CH2CO2H Basic information |
| Product Name: | Amino-PEG4-CH2CO2H | | Synonyms: | α-Amino-ω-carboxyl poly(ethylene glycol);Amino-PEG4-CH2CO2H;Amino-PEG4-acetic acid;AMINE-PEG4-CH2COOH;NH2-PEG4-CH2COOH;3,6,9,12-Tetraoxatetradecanoic acid, 14-amino-;Amino-PEG4;Amino-PEG4-CH2CO4H | | CAS: | 195071-49-9 | | MF: | C10H21NO6 | | MW: | 251.28 | | EINECS: | | | Product Categories: | PROTAC Linker;PROTAC;peg | | Mol File: | 195071-49-9.mol |  |
| | Amino-PEG4-CH2CO2H Chemical Properties |
| Boiling point | 397.6±32.0 °C(Predicted) | | density | 1.156±0.06 g/cm3(Predicted) | | storage temp. | 4°C, protect from light | | solubility | DMSO : 100 mg/mL (397.96 mM; Need ultrasonic) | | pka | 3.39±0.10(Predicted) | | form | solid | | color | White | | InChI | InChI=1S/C10H21NO6/c11-1-2-14-3-4-15-5-6-16-7-8-17-9-10(12)13/h1-9,11H2,(H,12,13) | | InChIKey | NPRAKTLKDKKZAV-UHFFFAOYSA-N | | SMILES | C(O)(=O)COCCOCCOCCOCCN |
| | Amino-PEG4-CH2CO2H Usage And Synthesis |
| Description | Amino-PEG4-CH2CO2H is a PEG linker containing an amino group with a terminal carboxylic acid. The hydrophilic PEG spacer increases solubility in aqueous media. The amino group is reactive with carboxylic acids, activated NHS esters, carbonyls (ketone, aldehyde) etc. The terminal carboxylic acid can be reacted with primary amine groups in the presence of activators (e.g. EDC, or DCC) to form a stable amide bond. | | Uses | Amino-PEG4-CH2CO2H is an important biological reagent for the synthesis of PROTAC and antibody-drug couplings (ADCs). It is also used to prepare Masp inhibitory compounds, Mertk degraders and pyruvate kinase inhibitors. | | IC 50 | PEGs; Non-cleavable Linker |
| | Amino-PEG4-CH2CO2H Preparation Products And Raw materials |
|