- Mal-PEG1-acid
-
-
2025-06-07
- CAS:760952-64-5
- Min. Order: 5g
- Purity: >98.00%
- Supply Ability: 5g
|
| | Mal-PEG1-acid Basic information |
| Product Name: | Mal-PEG1-acid | | Synonyms: | Mal-PEG1-acid;Mal-PEG1-CH2CH2COOH;3-[2-(2,5-Dioxo-2,5-dihydro-1h-pyrrol-1-yl)ethoxy]propanoic acid;Propanoic acid, 3-[2-(2,5-dihydro-2,5-dioxo-1H-pyrrol-1-yl)ethoxy]-;Mal-PEG1-CH2CH2COOH/Propanoic acid, 3-[2-(2,5-dihydro-2,5-dioxo-1H-pyrrol-1-yl)ethoxy]-;3-[2-(2,5-Dioxo-2,5-dihydro-1-pyrrolyl)ethoxy]propanoic Acid;3-[2-(2,5-dioxopyrrol-1-yl)ethoxy]propanoic acid;MAL-PEG1-PA | | CAS: | 760952-64-5 | | MF: | C9H11NO5 | | MW: | 213.19 | | EINECS: | | | Product Categories: | | | Mol File: | 760952-64-5.mol |  |
| | Mal-PEG1-acid Chemical Properties |
| Boiling point | 419.4±30.0 °C(Predicted) | | density | 1.383±0.06 g/cm3(Predicted) | | storage temp. | -20°C, protect from light | | pka | 4.27±0.10(Predicted) | | form | Solid | | color | White to off-white | | InChI | InChI=1S/C9H11NO5/c11-7-1-2-8(12)10(7)4-6-15-5-3-9(13)14/h1-2H,3-6H2,(H,13,14) | | InChIKey | YTZFUAXOTCJZHP-UHFFFAOYSA-N | | SMILES | C(O)(=O)CCOCCN1C(=O)C=CC1=O |
| | Mal-PEG1-acid Usage And Synthesis |
| Description | Mal-PEG1-acid is a PEG linker containing a maleimide group with a terminal carboxylic acid. The hydrophilic PEG spacer increases solubility in aqueous media. The maleimide group will react with a thiol group to form a covalent bond, enabling the connection of biomolecule with a thiol. The terminal carboxylic acid can react with primary amine groups in the presence of activators (e.g. EDC, or HATU) to form a stable amide bond. | | Biological Activity | Mal-PEG1-acid is a non-cleavable ADC linker containing 1 unit PEG, which can be used to synthesize antibody drug conjugates (ADC),it is a PROTAC linker belonging to the PEG class, which can be used to synthesize PROTAC molecules. | | in vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins. | | target | |
| | Mal-PEG1-acid Preparation Products And Raw materials |
|