- Sarsasapogenin
-
- $0.00 / 1kg
-
2026-04-20
- CAS:126-19-2
- Min. Order: 1kg
- Purity: ≥98% HPLC
- Supply Ability: 1000kg
- Sarsasapogenin
-
- $0.00 / 1kg
-
2026-04-20
- CAS:126-19-2
- Min. Order: 1kg
- Purity: ≥98% HPLC
- Supply Ability: 1000kg
- Sarsasapogenin
-
- $30.00 / 10mg
-
2026-04-16
- CAS:126-19-2
- Min. Order:
- Purity: 99.73%
- Supply Ability: 10g
|
| | Sarsasapogenin Basic information |
| | Sarsasapogenin Chemical Properties |
| Melting point | 194°C | | alpha | D25 -75°; 25546 -89° (c = 0.5 in CHCl3) | | Boiling point | 474.91°C (rough estimate) | | density | 1.0362 (rough estimate) | | refractive index | 1.4700 (estimate) | | storage temp. | 2-8°C | | solubility | DMF: 2 mg/ml; DMSO: 0.2 mg/ml; Ethanol: 2 mg/ml; Ethanol:PBS (pH 7.2)(1:2): 0.3 mg/ml | | pka | 15.14±0.70(Predicted) | | form | A crystalline solid | | color | White to off-white | | Optical Rotation | -7525 (c 0.5, CHCl3) | | Merck | 13,8456 | | Major Application | metabolomics vitamins, nutraceuticals, and natural products | | Cosmetics Ingredients Functions | SKIN CONDITIONING | | InChIKey | GMBQZIIUCVWOCD-WWASVFFGSA-N | | SMILES | C[C@H]1CC[C@@]2(OC1)O[C@H]3C[C@H]4[C@@H]5CC[C@@H]6C[C@@H](O)CC[C@]6(C)[C@H]5CC[C@]4(C)[C@H]3[C@@H]2C | | LogP | 6.210 (est) | | CAS DataBase Reference | 126-19-2(CAS DataBase Reference) | | NIST Chemistry Reference | Sarsasapogenin(126-19-2) |
| WGK Germany | 3 | | HS Code | 2932990090 | | Storage Class | 11 - Combustible Solids |
| | Sarsasapogenin Usage And Synthesis |
| Description | Smilagengenin is a steroidal saponin with antitumor activity, which is mainly used in refreshing beverages, foaming sweets, mixed wine, etc. | | Uses | Sarsasapogenin has cytotoxic properties and is used to develop lead structures for cancer drugs. Sarsasapogenin is also identified to effectively lower the production of Aβ amyloids and stimulate neurite ogrowth in neuronal cell cultures. | | Definition | ChEBI: (25S)-5beta-spirostan-3beta-ol is a sapogenin. | | in vivo | Sarsasapogenin (20 and 40 mg/kg) significantly restores the sucrose preference deficit induced by olfactory bulbectomy (OB), and increases locomotor activity. Sarsasapogenin groups (20 and 40 mg/kg) have significantly lower immobility times, higher AChE protein expression levels than the OB group. Furthermore, Sarsasapogenin (20 and 40 mg/kg) groups have significantly higher α7-nAChR protein expression, and increases higher α4-nAChR protein expression levels compared to rats in the OB group[2]. Sarsasapogenin (5 or 10 mg/kg, p.o.) inhibits TNBS-induced colon shortening and myeloperoxidase activity in mice, reducing NF-κB activation and interleukin (IL)-1β, tumor necrosis factor (TNF)-α, and IL-6 levels, while simultaneously increasing IL-10[3]. | | IC 50 | NF-κB |
| | Sarsasapogenin Preparation Products And Raw materials |
|