| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Tris(4-bromophenyl)aminium hexachloroantimonate Basic information |
| Product Name: | Tris(4-bromophenyl)aminium hexachloroantimonate | | Synonyms: | TRIS(4-BROMOPHENYL)AMINIUM HEXACHLORO-AN;TRIS(4-BROMOPHENYL)AMMONIUMYL HEXA- CHLOROANTIMONATE 97+%;Antimonate(1-), hexachloro-, (OC-6-11)-, salt with 4-bromo-N,N-bis(4-bromophenyl)benzenamine (1:1);Tris(4-bromophenyl)aminium hexachloroantimonate,95%;Tris(4-bromophenyl)aminium hexachloroantimonate,98%;Tris(4-broMophenyl)aMiniuM hexachloroantiMonate, 95% 5GR;4-bromo-N,N-bis(4-bromophenyl)anilinium chloride - pentachloro-lambda~5~-stibane (1:1);Tris(4-bromophenyl)amine, hexachlorostibate(V) salt | | CAS: | 24964-91-8 | | MF: | C18H13Br3Cl6NSb | | MW: | 817.49 | | EINECS: | | | Product Categories: | Others;Radical Chemistry;Stable Radicals | | Mol File: | 24964-91-8.mol |  |
| | Tris(4-bromophenyl)aminium hexachloroantimonate Chemical Properties |
| Melting point | 142 °C (dec.) (lit.) | | storage temp. | 2-8°C, protect from light | | form | solid | | Appearance | Brown to black Solid | | Stability: | Light and moisture sensitive. Incompatible with strong oxidizing agents. | | InChI | 1S/C18H12Br3N.6ClH.Sb/c19-13-1-7-16(8-2-13)22(17-9-3-14(20)4-10-17)18-11-5-15(21)6-12-18;;;;;;;/h1-12H;6*1H;/q+1;;;;;;;+5/p-6 | | InChIKey | SDHBPVANTRLAKE-UHFFFAOYSA-H | | SMILES | Cl[Sb-](Cl)(Cl)(Cl)(Cl)Cl.Brc1ccc(cc1)[N+](c2ccc(Br)cc2)c3ccc(Br)cc3 |
| Hazard Codes | Xn,N | | Risk Statements | 20/22-51/53 | | Safety Statements | 61 | | RIDADR | UN 3077 9/PG 3 | | WGK Germany | 2 | | F | 9-23 | | HS Code | 29239000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Inhalation
Acute Tox. 4 Oral
Aquatic Chronic 2 |
| | Tris(4-bromophenyl)aminium hexachloroantimonate Usage And Synthesis |
| Chemical Properties | crystalline powder | | Uses | Tris(4-bromophenyl)ammoniumyl hexachloroantimonate can be used as a strong oxidant for the chemical doping of conjugated polymers. It can also be used as a catalyst for the deprotection of tert-butyldimethylsilyl and tetrahydropyranyl ethers. |
| | Tris(4-bromophenyl)aminium hexachloroantimonate Preparation Products And Raw materials |
|