- 1-BROMO-2,4-DICHLOROBENZENE
-
- $100.00 / 1KG
-
2025-09-25
- CAS:1193-72-2
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: g-kg-tons, free sample is available
|
| | 1-BROMO-2,4-DICHLOROBENZENE Basic information |
| Product Name: | 1-BROMO-2,4-DICHLOROBENZENE | | Synonyms: | 1-BROMO-2,4-DICHLOROBENZENE;BROMO(2-)-4-DICHLOROBENZENE;2,4-Dichloro Bromo Benzene 4'-Phenyl Acetophenone;1-Bromo-2,4-dichlorobenzene, 98+%;1-BROMO-2,4-DICHLOROBENZENE / 2,4-DICHLOROBROMOBENZENE;Benzene, 1-bromo-2,4-dichloro-;2,4-DICHLOROBROMOBENZENE;1-Bromo-2,4-dichlorobenzene,99% | | CAS: | 1193-72-2 | | MF: | C6H3BrCl2 | | MW: | 225.9 | | EINECS: | 214-778-6 | | Product Categories: | Building Blocks;Chemical Synthesis;Halogenated Hydrocarbons;Organic Building Blocks;Benzene derivates;Bromine Compounds;Chlorine Compounds;Aryl;Halogenated Hydrocarbons;C6 | | Mol File: | 1193-72-2.mol |  |
| | 1-BROMO-2,4-DICHLOROBENZENE Chemical Properties |
| Melting point | 26-30 °C(lit.) | | Boiling point | 235°C | | density | 1,89 g/cm3 | | refractive index | 1.5700 (estimate) | | Fp | >230 °F | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | form | powder to lump to clear liquid | | color | White or Colorless to Light yellow | | Water Solubility | Slightly soluble in water. | | BRN | 1635733 | | InChI | InChI=1S/C6H3BrCl2/c7-5-2-1-4(8)3-6(5)9/h1-3H | | InChIKey | ISHYFWKKWKXXPL-UHFFFAOYSA-N | | SMILES | C1(Br)=CC=C(Cl)C=C1Cl | | CAS DataBase Reference | 1193-72-2(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36-37/39 | | RIDADR | UN 2810 6.1/PG 1 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29039990 |
| | 1-BROMO-2,4-DICHLOROBENZENE Usage And Synthesis |
| Chemical Properties | colorless to light yellow crystalline mass or | | Uses | 1-Bromo-2,4-dichlorobenzene is used to produce 2,4,4'-trichloro-biphenyl. This reaction will need aq. Na2CO3 and solvents dioxane, ethanol. It is an important raw material and intermediate used in organic synthesis, pharmaceuticals, agrochemicals and dyestuff fields. | | General Description | 1-Bromo-2,4-dichlorobenzene is an aryl halide. It can be distinguished from the other bromodichlorobenzene isomers using IR and Raman spectral data. It can undergo Suzuki–Miyaura cross-coupling reaction with arylboronic acids in the presence of different Suzuki catalysts. |
| | 1-BROMO-2,4-DICHLOROBENZENE Preparation Products And Raw materials |
| Raw materials | 2,4-DICHLOROBENZENE DIAZONIUM-->2,4-dichloro-1-methylsulfinyl-benzene-->BENZENAMINE, 5-BROMO-2,4-DICHLORO--->2,4-Dichlorophenylhydrazine hydrochloride-->1,2,4-Trichlorobenzene-->1,3-Dichlorobenzene-->2,4-Dichloroaniline-->Methanesulfonyl chloride | | Preparation Products | 2,4-DICHLOROBIPHENYL-->2,4-Dichloro-p-terphenyl@50 μg/mL in Toluene-->2-Bromo-1,5-dichloro-3-nitro-benzene-->1-(2,4-DICHLOROPHENYL)PIPERAZINE-->2,4,4'-TRICHLOROBIPHENYL |
|