|
|
| | 1-BROMO-2,6-DICHLOROBENZENE Basic information |
| Product Name: | 1-BROMO-2,6-DICHLOROBENZENE | | Synonyms: | 2,6-DICHLORO BROMO BENZENE;1-BROMO-2,6-DICHLOROBENZENE;Benzene, 2-bromo-1,3-dichloro-;BROMO-2 6-DICHLOROBENZENE 99%;2,6-DICHLOROPHENYL BROMIDE;2,6-Dichloro-1-bromobenzene;1-Bromo-2,6-dichlorobenzene,99%;1-BroMo-2,6-dichlorobenzene, 98%+ | | CAS: | 19393-92-1 | | MF: | C6H3BrCl2 | | MW: | 225.9 | | EINECS: | 243-018-6 | | Product Categories: | Bromine Compounds;Chlorine Compounds;Aryl;Halogenated Hydrocarbons;C6 | | Mol File: | 19393-92-1.mol |  |
| | 1-BROMO-2,6-DICHLOROBENZENE Chemical Properties |
| Melting point | 61-64 °C (lit.) | | Boiling point | 242 °C/765 mmHg (lit.) | | density | 1.6351 (rough estimate) | | refractive index | 1.5700 (estimate) | | Fp | >100°C | | storage temp. | Sealed in dry,Room Temperature | | form | Crystalline Powder and/or Chunks | | color | White to yellow | | BRN | 1681054 | | InChI | InChI=1S/C6H3BrCl2/c7-6-4(8)2-1-3-5(6)9/h1-3H | | InChIKey | UWOIDOQAQPUVOH-UHFFFAOYSA-N | | SMILES | C1(Cl)=CC=CC(Cl)=C1Br | | CAS DataBase Reference | 19393-92-1(CAS DataBase Reference) | | NIST Chemistry Reference | Benzene, 1-bromo-2,6-dichloro-(19393-92-1) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39-28A | | WGK Germany | 3 | | Hazard Note | Irritant | | HS Code | 29039990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 1-BROMO-2,6-DICHLOROBENZENE Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powder | | Uses | 1-Bromo-2,6-dichlorobenzene is used in biological studies to evaluate the toxicity of arylhalides and benzylhalides to Daphnia magna. | | General Description | Extent of debromination of 1-bromo-2,6-dichlorobenzene in several aprotic solvents has been evaluated. |
| | 1-BROMO-2,6-DICHLOROBENZENE Preparation Products And Raw materials |
|