|
|
| | L-Serinamide hydrochloride Basic information |
| | L-Serinamide hydrochloride Chemical Properties |
| Melting point | 185-188 °C(lit.) | | alpha | 14 º (c=1, H2O) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | form | Crystals or Crystalline Powder | | color | Red to purple | | Optical Rotation | [α]20/D +14°, c = 1 in H2O | | InChI | InChI=1/C3H8N2O2.ClH/c4-2(1-6)3(5)7;/h2,6H,1,4H2,(H2,5,7);1H/t2-;/s3 | | InChIKey | VURWDDZIWBGXCK-NNUCSGGJNA-N | | SMILES | [C@H](N)(CO)C(=O)N.Cl |&1:0,r| | | CAS DataBase Reference | 65414-74-6(CAS DataBase Reference) |
| Safety Statements | 24/25 | | WGK Germany | 3 | | HS Code | 29241990 |
| | L-Serinamide hydrochloride Usage And Synthesis |
| Chemical Properties | white to off-white crystals or powder | | Uses | L-Serinamide Hydrochloride is used in the green synthesis of bioactive Oligopeptides. | | reaction suitability | reaction type: solution phase peptide synthesis | | Synthesis | General procedure for the synthesis of (S)-2-amino-3-hydroxypropionamide hydrochloride from L-serine methyl ester hydrochloride: 3.5 g (0.0225 mol) of L-serine methyl ester hydrochloride was dissolved in 100 mL of ammonia and the reaction was stirred for 48 hours at room temperature. Upon completion of the reaction, the ammonia was removed by distillation under reduced pressure, and a small amount of dilute hydrochloric acid was added to the residue to dissolve it, followed by freeze-drying of the solution to give 2.8 g of a light yellow solid product, L-serine hydrochloride, in 87.5% yield. | | References | [1] Patent: CN103804341, 2018, B. Location in patent: Paragraph 0049; 0051; 0052 |
| | L-Serinamide hydrochloride Preparation Products And Raw materials |
|