| Company Name: |
SHANG FLUORO Gold |
| Tel: |
021-65170832 15601903708 |
| Email: |
qinba_1@163.com |
|
| | 2,3,5,6-Tetrafluoro-4-methylbenzyl alcohol Basic information |
| Product Name: | 2,3,5,6-Tetrafluoro-4-methylbenzyl alcohol | | Synonyms: | 2,3,5,6-TETRAFLUORO-4-METHYLBENZYL ALCOHOL;2,3,5,6-TETRAFLUORO-4-METHYLBENYL ALCOHOL;4-METHYL-2,3,5,6-TETRAFLUOROBENZENEMETHANOL;(4-Methyl-2,3,5,6-tetrafluorophenyl)methanol, 4-(Hydroxymethyl)-2,3,5,6-tetrafluorotoluene;(2,3,5,6-Tetrafluoro-4-Methylphenyl)Methanol;Tefluthrin Related Compound 1;Benzenemethanol, 2,3,5,6-tetrafluoro-4-methyl-;2,3,5,6-Tetrafluoro-4-methylbenzyl alcohol Basic information | | CAS: | 79538-03-7 | | MF: | C8H6F4O | | MW: | 194.13 | | EINECS: | 616-698-0 | | Product Categories: | | | Mol File: | 79538-03-7.mol |  |
| | 2,3,5,6-Tetrafluoro-4-methylbenzyl alcohol Chemical Properties |
| Melting point | 61-62°C | | Boiling point | 201.4±35.0 °C(Predicted) | | density | 1.423±0.06 g/cm3(Predicted) | | storage temp. | -20°C Freezer | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | pka | 12.95±0.10(Predicted) | | color | White to Off-White | | InChI | InChI=1S/C8H6F4O/c1-3-5(9)7(11)4(2-13)8(12)6(3)10/h13H,2H2,1H3 | | InChIKey | PJCSTULKVNHEGW-UHFFFAOYSA-N | | SMILES | C1(CO)=C(F)C(F)=C(C)C(F)=C1F | | CAS DataBase Reference | 79538-03-7(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | Hazard Note | Irritant | | HS Code | 2906290020 |
| | 2,3,5,6-Tetrafluoro-4-methylbenzyl alcohol Usage And Synthesis |
| Chemical Properties | Colorless solid | | Uses | 2,3,5,6-Tetrafluoro-4-methylbenzyl alcohol is an intermediate of heptaflupyrrol. |
| | 2,3,5,6-Tetrafluoro-4-methylbenzyl alcohol Preparation Products And Raw materials |
|