- FMOC-GLU(OALL)-OH
-
- $1000.00 / 1KG
-
2019-07-06
- CAS:133464-46-7
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 10ton
- FMOC-GLU(OALL)-OH
-
- $1.00 / 1KG
-
2019-07-06
- CAS:133464-46-7
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 20kg
|
| | FMOC-GLU(OALL)-OH Basic information |
| Product Name: | FMOC-GLU(OALL)-OH | | Synonyms: | FMoc-Glu(OAll)-OH FMoc-L-glutaMic acid γ-allyl ester;FMOC-GLU(OALL)-OHFMOC-GL;(S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)-amino)-5-(allyloxy)-5-oxopentanoic acid;5-Allyl N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-glutamate;Fmoc-L-glutamic acid γ-allyl ester≥ 98% (HPLC);N-Fmoc-L-glutamic acid 5-allyl ester;FMOC-L-GLUTAMIC ACID 5-ALLYL ESTER;FMOC-L-GLU(ALL)-OH | | CAS: | 133464-46-7 | | MF: | C23H23NO6 | | MW: | 409.43 | | EINECS: | | | Product Categories: | Glutamic acid [Glu, E] | | Mol File: | 133464-46-7.mol |  |
| | FMOC-GLU(OALL)-OH Chemical Properties |
| Melting point | 122 - 128°C | | Boiling point | 650.1±55.0 °C(Predicted) | | density | 1.264±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | soluble in Methanol | | pka | 3.70±0.10(Predicted) | | form | Powder | | color | White | | Optical Rotation | [α]20/D 16.5±2°, c = 1% in DMF | | BRN | 6670846 | | Major Application | peptide synthesis | | InChI | 1S/C23H23NO6/c1-2-13-29-21(25)12-11-20(22(26)27)24-23(28)30-14-19-17-9-5-3-7-15(17)16-8-4-6-10-18(16)19/h2-10,19-20H,1,11-14H2,(H,24,28)(H,26,27)/t20-/m0/s1 | | InChIKey | LRBARFFNYOKIAX-FQEVSTJZSA-N | | SMILES | C(O)(=O)[C@H](CCC(OCC=C)=O)NC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O | | CAS DataBase Reference | 133464-46-7(CAS DataBase Reference) |
| | FMOC-GLU(OALL)-OH Usage And Synthesis |
| Chemical Properties | White powder | | Uses | peptide synthesis | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | FMOC-GLU(OALL)-OH Preparation Products And Raw materials |
|