|
|
| Product Name: | 2,6-Difluoroanisole | | Synonyms: | 2,6-DIFLUOROANISOLE;2,6-Difluoroanisole, 97+%;2,6-Difluoroanisole 98%;2,6-Difluoroanisole98%;2,6-DIFLUOROANISOLE: 98.5%;2,6-Difluoroanisole>Benzene, 1,3-difluoro-2-methoxy-;2,6-Difluoroanisole ISO 9001:2015 REACH | | CAS: | 437-82-1 | | MF: | C7H6F2O | | MW: | 144.12 | | EINECS: | | | Product Categories: | Fluorine Compounds;Anisole;Anisoles, Alkyloxy Compounds & Phenylacetates | | Mol File: | 437-82-1.mol |  |
| | 2,6-Difluoroanisole Chemical Properties |
| Boiling point | 70-72°C 56mm | | density | 1.221 | | refractive index | 1.4570 to 1.4620 | | Fp | 61°C | | storage temp. | Sealed in dry,Room Temperature | | form | clear liquid | | color | Colorless to Light yellow | | Specific Gravity | 1.2350 | | InChI | InChI=1S/C7H6F2O/c1-10-7-5(8)3-2-4-6(7)9/h2-4H,1H3 | | InChIKey | IOBWAHRFIPQEQL-UHFFFAOYSA-N | | SMILES | C1(F)=CC=CC(F)=C1OC | | CAS DataBase Reference | 437-82-1(CAS DataBase Reference) |
| Hazard Codes | Xi,F | | Risk Statements | 10-36/37/38 | | Safety Statements | 16-26-36 | | RIDADR | 1993 | | Hazard Note | Flammable | | HazardClass | 3 | | PackingGroup | III | | HS Code | 2909309090 |
| Provider | Language |
|
ALFA
| English |
| | 2,6-Difluoroanisole Usage And Synthesis |
| physical state | 2,6-Difluoroanisole is a Liquid. | | Uses | 2,6-Difluoroanisole is an ether derivative and can be used as an organic reagent. |
| | 2,6-Difluoroanisole Preparation Products And Raw materials |
|