| Company Name: |
Tenghong (Shandong) New Material Co., Ltd
|
| Tel: |
1555-2555846 18265060865 |
| Email: |
1277177917@qq.com |
| Products Intro: |
Cas:1094-61-7
ProductName:Nicotinamide mononucleotide
Purity: 99% | Package: 1KG;25KG;50KG;100KG;200KG
|
| Company Name: |
Shenzhen Hyra Biotech Co., Ltd
|
| Tel: |
0755-27208059 15115151094 |
| Email: |
sylvia@hygieia.com.cn |
| Products Intro: |
Cas:1094-61-7
ProductName:β-Nicotinamide Mononucleotide; NMN; Beta-Nicotinamide Mononucleotide
Purity: 99.9%
|
| Company Name: |
Hubei Norna Technology Limited Company
|
| Tel: |
59209883 17386169806 |
| Email: |
service@nornachem.com |
| Products Intro: |
Cas:1094-61-7
ProductName:β-Nicotinamide Mononucleotide
Purity: 0.98
|
|
| | Nicotinamide Mononucleotide Basic information |
| | Nicotinamide Mononucleotide Chemical Properties |
| Melting point | 166 °C(dec.) | | storage temp. | -20°C | | solubility | DMSO (Slightly, Heated), Methanol (Slightly), Water (Slightly) | | form | Solid | | color | White to Yellow | | Merck | 13,6697 | | BRN | 3570187 | | Stability: | Very Hygroscopic | | Cosmetics Ingredients Functions | ANTIOXIDANT | | InChI | InChI=1/C11H15N2O8P/c12-10(16)6-2-1-3-13(4-6)11-9(15)8(14)7(21-11)5-20-22(17,18)19/h1-4,7-9,11,14-15H,5H2,(H3-,12,16,17,18,19)/t7-,8-,9-,11-/s3 | | InChIKey | DAYLJWODMCOQEW-TURQNECASA-N | | SMILES | O[C@@H]1[C@@H]([C@@H](COP(O)([O-])=O)O[C@H]1[N+]1=CC=CC(C(=O)N)=C1)O |&1:1,2,3,11,r| |
| WGK Germany | 3 | | F | 8-10-21 | | HS Code | 2934999090 | | Storage Class | 11 - Combustible Solids |
| | Nicotinamide Mononucleotide Usage And Synthesis |
| Description | Nicotinamide Mononucleotide(NMN) is a molecule your body makes naturally, but some people also take it as a supplement. It’s a precursor of nicotinamide adenine dinucleotide (NAD+) and a driving force in the body’s production of NAD+, which is an essential coenzyme involved in multiple biological processes including aging and gene expression. Nicotinamide Mononucleotide may help improve insulin sensitivity and heart function and reduce tiredness with few side effects. | | benefits | Nicotinamide converts to Nicotinamide Mononucleotide, which then converts to NAD+ once it enters the body. An NAD+ deficiency can lead to potential health issues, including age-related metabolic disorders, mental disorders and neurodegenerative diseases.BE | | Safety | Existing human clinical trials suggest that oral NMN administration is generally safe, and although only a limited number of indicators were studied, the results suggest that NMN has potential as an antiaging agent. However, there are still obstacles that need to be addressed before NMN-containing products can be confidently marketed. |
| | Nicotinamide Mononucleotide Preparation Products And Raw materials |
| Preparation Products | NADPH |
|