| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Ethyl N-Boc-piperidine-2-carboxylate Basic information |
| Product Name: | Ethyl N-Boc-piperidine-2-carboxylate | | Synonyms: | METHYL N-BOC-PIPECOLINATE;1-TERT-BUTYL 2-METHYL PIPERIDINE-1,2-DICARBOXYLATE;TERT-BUTYL METHYL PIPERIDINE-1,2-DICARBOXYLATE;1-tert-butyl-2-methylpiperidin-1-ium-1,2-dicarboxylate;1-(1,1-Dimethylethyl) 2-ethyl (±)-1,2-piperidinedicarboxylate;1,2-Piperidinedicarboxylic acid, 1-(1,1-dimethylethyl) 2-methyl ester;1-[(tert-butoxy)carbonyl]-3-Methylpiperidine-2-carboxylate;Methyl 1-(tert-Butoxycarbonyl)-2-piperidinecarboxylate | | CAS: | 167423-93-0 | | MF: | C12H21NO4 | | MW: | 243.3 | | EINECS: | 205-516-1 | | Product Categories: | | | Mol File: | 167423-93-0.mol |  |
| | Ethyl N-Boc-piperidine-2-carboxylate Chemical Properties |
| Boiling point | 307.4±35.0 °C(Predicted) | | density | 1.094±0.06 g/cm3(Predicted) | | refractive index | 1.46 | | storage temp. | Sealed in dry,Room Temperature | | pka | -3.28±0.40(Predicted) | | form | clear liquid | | color | Colorless to Light yellow to Light orange | | InChI | InChI=1S/C12H21NO4/c1-12(2,3)17-11(15)13-8-6-5-7-9(13)10(14)16-4/h9H,5-8H2,1-4H3 | | InChIKey | PVMJFJDVCVNWQN-UHFFFAOYSA-N | | SMILES | N1(C(OC(C)(C)C)=O)CCCCC1C(OC)=O |
| | Ethyl N-Boc-piperidine-2-carboxylate Usage And Synthesis |
| Uses | Substrate of Ethyl N-Boc-piperidine-2-carboxylate can be used in a palladium-catalyzed α-arylation of esters with
heterocyclic bromides and chlorides leading to, for example,
4-pyridylpiperidinyl esters. |
| | Ethyl N-Boc-piperidine-2-carboxylate Preparation Products And Raw materials |
|