|
|
| | Fmoc-O-Phospho-L-tyrosine Basic information |
| | Fmoc-O-Phospho-L-tyrosine Chemical Properties |
| density | 1.464±0.06 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | form | Powder | | pka | 1.27±0.30(Predicted) | | color | White to off-white | | BRN | 6674324 | | Major Application | peptide synthesis | | InChIKey | AMXUJIHSMANWDW-QFIPXVFZSA-N | | SMILES | C(O)(=O)[C@H](CC1=CC=C(OP(O)(O)=O)C=C1)NC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O | | CAS DataBase Reference | 147762-53-6(CAS DataBase Reference) |
| WGK Germany | 3 | | F | 10 | | HS Code | 29224999 | | Storage Class | 11 - Combustible Solids |
| | Fmoc-O-Phospho-L-tyrosine Usage And Synthesis |
| Chemical Properties | White to off-white powder | | Uses | Fmoc-O-phospho-L-tyrosine is used in the synthesis of an asparagine mimetic-containing phosphopeptide as an antagonist of the Grb2-SH2 domain. | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | Fmoc-O-Phospho-L-tyrosine Preparation Products And Raw materials |
|