| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
- Fmoc-L-Tyr-OH
-
-
2026-09-11
- CAS:92954-90-0
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1T
|
| | Nalpha-Fmoc-L-tyrosine Basic information |
| | Nalpha-Fmoc-L-tyrosine Chemical Properties |
| Melting point | 182-187 °C | | alpha | -22 º (c=1%, DMF) | | Boiling point | 672.6±55.0 °C(Predicted) | | density | 1.336±0.06 g/cm3(Predicted) | | refractive index | -22.0 ° (C=1, DMF) | | storage temp. | 2-8°C | | solubility | soluble in Methanol | | form | powder to crystal | | pka | 2.95±0.10(Predicted) | | color | White to Almost white | | Optical Rotation | [α]20/D 22±2°, c = 1% in DMF | | BRN | 3573123 | | Major Application | peptide synthesis | | InChI | 1S/C24H21NO5/c26-16-11-9-15(10-12-16)13-22(23(27)28)25-24(29)30-14-21-19-7-3-1-5-17(19)18-6-2-4-8-20(18)21/h1-12,21-22,26H,13-14H2,(H,25,29)(H,27,28)/t22-/m0/s1 | | InChIKey | SWZCTMTWRHEBIN-QFIPXVFZSA-N | | SMILES | OC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)OCC2c3ccccc3-c4ccccc24 | | CAS DataBase Reference | 92954-90-0(CAS DataBase Reference) |
| | Nalpha-Fmoc-L-tyrosine Usage And Synthesis |
| Chemical Properties | Off-white powder | | Uses | N-Fmoc-L-tyrosine is an N-Fmoc-protected form of L-Tyrosine. L-Tyrosine is an essential amino acid that exhibits in vitro antioxidant and antiradical activities. L-Tyrosine is used as a precursor to synthesize catecholamines (e.g. Norepinephrine HCl [N674500]) in human keratinocytes, and also for the synthesis of proteins and thyroid hormones. | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | Nalpha-Fmoc-L-tyrosine Preparation Products And Raw materials |
|