|
|
| | Glycyl-L-aspartic acid Basic information |
| | Glycyl-L-aspartic acid Chemical Properties |
| Melting point | ~205 °C | | Boiling point | 468.7±45.0 °C(Predicted) | | density | 1.499±0.06 g/cm3(Predicted) | | refractive index | 13 ° (C=2, H2O) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | Water Solubility | almost transparency in Water | | form | powder to crystal | | pka | 2.92±0.10(Predicted) | | color | White to Almost white | | Optical Rotation | [α]20/D +12.0±2°, c = 5% in H2O | | BRN | 1727387 | | Major Application | peptide synthesis | | InChI | 1S/C6H10N2O5/c7-2-4(9)8-3(6(12)13)1-5(10)11/h3H,1-2,7H2,(H,8,9)(H,10,11)(H,12,13)/t3-/m0/s1 | | InChIKey | SCCPDJAQCXWPTF-VKHMYHEASA-N | | SMILES | NCC(=O)N[C@@H](CC(O)=O)C(O)=O | | CAS DataBase Reference | 4685-12-5(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 37/38-41 | | Safety Statements | 26-39 | | WGK Germany | 3 | | F | 21 | | HS Code | 2924190090 | | Storage Class | 11 - Combustible Solids |
| | Glycyl-L-aspartic acid Usage And Synthesis |
| Uses | Glycyl-L-aspartic Acid is a reagent used in the preparation of environmentally benign CO2-based copolymers. | | Definition | ChEBI: A dipeptide formed from glycyl and L-aspartic acid residues. | | reaction suitability | reaction type: solution phase peptide synthesis |
| | Glycyl-L-aspartic acid Preparation Products And Raw materials |
|