| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
N-(N-Propyl)acetamide manufacturers
- N-(N-PROPYL)ACETAMIDE
-
- $1.10
-
2026-08-20
- CAS:5331-48-6
- Min. Order: 1g
- Purity: 99.00%
- Supply Ability: 100 Tons Min
|
| | N-(N-Propyl)acetamide Basic information |
| Product Name: | N-(N-Propyl)acetamide | | Synonyms: | Acetamide, N-n-propyl-,;Acetamide, N-propyl-;N-(n-Propyl)acetamide,98%;Inchi=1/C5H11no/C1-3-4-6-5(2)7/H3-4H2,1-2H3,(H,6,7;N-(N-PROPYL)ACETAMIDE ISO 9001:2015 REACH;acetyl propyl amine;N-Propylacetamide;N-(N-Propyl)acetamide | | CAS: | 5331-48-6 | | MF: | C5H11NO | | MW: | 101.15 | | EINECS: | 226-231-9 | | Product Categories: | | | Mol File: | 5331-48-6.mol |  |
| | N-(N-Propyl)acetamide Chemical Properties |
| density | 0,912 g/cm3 | | refractive index | 1.4370 | | storage temp. | Storage temp. 2-8°C | | Appearance | Colorless to light yellow Liquid | | BRN | 1699600 | | LogP | 0.320 (est) | | CAS DataBase Reference | 5331-48-6 |
| Provider | Language |
|
ALFA
| English |
| | N-(N-Propyl)acetamide Usage And Synthesis |
| | N-(N-Propyl)acetamide Preparation Products And Raw materials |
|