|
|
| | 2-Bromo-4-nitroimidazole Basic information |
| | 2-Bromo-4-nitroimidazole Chemical Properties |
| Melting point | 232.0 to 236.0 °C | | Boiling point | 402.5±37.0 °C(Predicted) | | density | 2.156±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | form | Solid | | pka | 5.65±0.10(Predicted) | | color | White to Yellow | | InChI | InChI=1S/C3H2BrN3O2/c4-3-5-1-2(6-3)7(8)9/h1H,(H,5,6) | | InChIKey | UWRJWMLKEHRGOH-UHFFFAOYSA-N | | SMILES | C1(Br)NC([N+]([O-])=O)=CN=1 | | CAS DataBase Reference | 65902-59-2(CAS DataBase Reference) |
| | 2-Bromo-4-nitroimidazole Usage And Synthesis |
| Chemical Properties | Light yellow powder | | Uses |
A key building block for nitroimidazole drugs.
| | Synthesis | 2-bromo-4-nitroimidazole is synthesized by dibromination of 4-nitroimidazole followed by selective debromination using in situ reductive deiodination strategy. | | References | [1] Patent: EP2141151, 2010, A1. Location in patent: Page/Page column 8 |
| | 2-Bromo-4-nitroimidazole Preparation Products And Raw materials |
|