- CTP disodium dihydrate
-
- $0.00 / 1removed
-
2026-03-13
- CAS:81012-87-5
- Min. Order:
- Purity: 100%
- Supply Ability: 10g
|
| | Cytidine-5'-triphosphate disodium salt dihydrate Basic information |
| Product Name: | Cytidine-5'-triphosphate disodium salt dihydrate | | Synonyms: | CTP(Cytidine Triphosphate DisodiuM);Cytidine-5'-triphosphate(CTP) disodium salt dihydrate;Sodium ((2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1(2H)-yl)-3,4-dihydroxytetrahydrofuran-2-yl)methyl dihydrogentriphosphate dihydrate;-triphosphate disodium solution;methyl dihydrogentriphosphate dihydrate;CTP DISODIUM SALT DIHYDRATE;CYTIDINE 5'-TRIPHOSPHATE DISODIUM SALT DIHYDRATE;Cytidine to 5'-Triphosphate Disodium Salt Dihydrate | | CAS: | 81012-87-5 | | MF: | C9H19N3NaO15P3 | | MW: | 525.17 | | EINECS: | 815-308-8 | | Product Categories: | API;Amino Acids | | Mol File: | 81012-87-5.mol |  |
| | Cytidine-5'-triphosphate disodium salt dihydrate Chemical Properties |
| Melting point | 215-218 °C | | Fp | >230 °F | | storage temp. | Keep in dark place,Inert atmosphere,Store in freezer, under -20°C | | solubility | H2O: 50 mg/mL, clear, colorless | | form | Crystalline Powder | | color | colorless | | Stability: | Hygroscopic | | InChIKey | ZLCQKPRKZPUJJM-IROIDLSJNA-N | | SMILES | O[C@@H]1[C@@H]([C@@H](COP(O)(=O)OP(O)(=O)OP(O)(O)=O)O[C@H]1N1C=CC(N)=NC1=O)O.[NaH].O |&1:1,2,3,19,r| | | CAS DataBase Reference | 81012-87-5(CAS DataBase Reference) |
| | Cytidine-5'-triphosphate disodium salt dihydrate Usage And Synthesis |
| Chemical Properties | White crystalline powder | | Chemical Properties | Cytidine-5'-triphosphate disodium salt dihydrate is a white crystalline powder. Its melting point is 215–218°C. It is hygroscopic and must be stored in an inert atmosphere at -20°C to maintain its stability, protected from light. The compound is well-soluble in water, with a solubility of approximately 50 mg/mL, forming a clear, colorless solution. | | Uses | A disodium dihydrate form of CTP (CAS# 65-47-4) used in the radiolabeling of DNA restriction endonuclease fragments. | | Application | Cytidine-5'-triphosphate (CTP) is one of the important nucleoside triphosphates in living organisms. Its disodium salt dihydrate form primarily serves as a substrate for ribonucleic acid (RNA) synthesis, providing essential cytidine units for RNA chain elongation during transcription. Furthermore, Cytidine-5'-triphosphate disodium salt dihydrate plays a crucial role in cellular metabolism, such as participating in the biosynthesis of phosphatidylcholine (PC) and, through its reaction with phosphatidylcholine, serving as an important precursor for cell membrane structure and signal transduction. |
| | Cytidine-5'-triphosphate disodium salt dihydrate Preparation Products And Raw materials |
|