- (S)-3-Methyl-β-alanine
-
- $10.00
-
2021-10-28
- CAS:3775-72-2
- Min. Order: 1Kg/Bag
- Purity: 99%
- Supply Ability: 20 Tons
|
| | (S)-3-Aminobutyric acid Basic information |
| Product Name: | (S)-3-Aminobutyric acid | | Synonyms: | (S)-beta-homoalanine;L-3-AMINOBUTYRIC ACID;L-BETA-AMINO-N-BUTYRIC ACID;(S)-B-AMINOBUTYRIC ACID;(3S)-3-Aminobutanoic acid;(3S)-3-Aminobutyric acid;(S)-3-Methyl-β-alanine;beta-homo-L-alanine | | CAS: | 3775-72-2 | | MF: | C4H9NO2 | | MW: | 103.12 | | EINECS: | | | Product Categories: | | | Mol File: | 3775-72-2.mol |  |
| | (S)-3-Aminobutyric acid Chemical Properties |
| Melting point | 229-231°C | | Boiling point | 223.6±23.0 °C(Predicted) | | density | 1.105±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | Water Solubility | Soluble in water | | pka | 3.67±0.12(Predicted) | | form | powder to crystal | | color | White to Almost white | | Optical Rotation | Consistent with structure | | InChI | InChI=1S/C4H9NO2/c1-3(5)2-4(6)7/h3H,2,5H2,1H3,(H,6,7)/t3-/m0/s1 | | InChIKey | OQEBBZSWEGYTPG-VKHMYHEASA-N | | SMILES | C(O)(=O)C[C@@H](N)C |
| Hazard Codes | Xi | | Risk Statements | 36 | | Safety Statements | 26 | | WGK Germany | 3 | | HS Code | 2922.49.4950 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 |
| | (S)-3-Aminobutyric acid Usage And Synthesis |
| Chemical Properties | White powder | | Uses | (S)-3-Aminobutanoic Acid can be used as herbicides. | | General Description | (S)-3-Aminobutyric acid is a nonproteogenic amino acid. | | Purification Methods | Purify the acid through Amberlite IR-4B (20-50 mesh) washing wth H2O, evaporating in a vacuum, then recrystallise it twice from absolute EtOH. It has also been crystallised from MeOH or MeOH/Et2O and dried in a vacuum. [Balenovic et al. J Chem Soc 3316 1952, Bruylants Bull Soc Chim Belg 32 259 1923, Beilstein 4 IV 2595.] |
| | (S)-3-Aminobutyric acid Preparation Products And Raw materials |
|