| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 2-Chloro-6-methyl-4-(trifluoromethyl)pyridine Basic information |
| Product Name: | 2-Chloro-6-methyl-4-(trifluoromethyl)pyridine | | Synonyms: | 2-CHLORO-6-METHYL-4-(TRIFLUOROMETHYL)PYRIDINE;2-Chloro-6-methyl-4-(trifluoromethyl)pyridine 97%;2-Chloro-6-methyl-4-(trifluoromethyl)pyridine97%;2-Methyl-6-chlor-4-trifluormethylpyridine;6-Chloro-4-(trifluoromethyl)-2-picoline;2-Chloro-6-Methyl-4-(trifluoroMethyl)pyridine;Pyridine, 2-chloro-6-methyl-4-(trifluoromethyl)- | | CAS: | 22123-14-4 | | MF: | C7H5ClF3N | | MW: | 195.57 | | EINECS: | | | Product Categories: | Pyridine;Pyridine series | | Mol File: | 22123-14-4.mol |  |
| | 2-Chloro-6-methyl-4-(trifluoromethyl)pyridine Chemical Properties |
| Boiling point | 66 °C | | density | 1.354±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | form | liquid | | pka | -0.38±0.10(Predicted) | | color | Colourless to light yellow | | InChI | InChI=1S/C7H5ClF3N/c1-4-2-5(7(9,10)11)3-6(8)12-4/h2-3H,1H3 | | InChIKey | SXLBWNSGCIEART-UHFFFAOYSA-N | | SMILES | C1(Cl)=NC(C)=CC(C(F)(F)F)=C1 | | CAS DataBase Reference | 22123-14-4(CAS DataBase Reference) |
| Hazard Codes | Xi,Xn,T | | Risk Statements | 20/21/22-36/37/38-25 | | Safety Statements | 23-36/37/39-45-26 | | RIDADR | UN 2811 6.1 / PGIII | | Hazard Note | Harmful | | HazardClass | IRRITANT | | HS Code | 2933399990 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | 2-Chloro-6-methyl-4-(trifluoromethyl)pyridine Usage And Synthesis |
| | 2-Chloro-6-methyl-4-(trifluoromethyl)pyridine Preparation Products And Raw materials |
|