| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 2,6-Dichloro-4-(trifluoromethyl)pyridine Basic information |
| Product Name: | 2,6-Dichloro-4-(trifluoromethyl)pyridine | | Synonyms: | 4-TRIFLUOROMETHYL-2,6-DICHLOROPYRIDINE;2,6-DICHLORO-4-(TRIFLUOROMETHYL)PYRIDINE;4-TrifluoroMethyl-2,6-dichloroprydine;2,6-Dichloro-alpha,alpha,alpha-trifluoro-4-picoline;2,6-Dichloro-4-(trifluoromethyl)pyridine 98%;2,6-Dichloro-4-(trifluoromethyl)pyridine>Pyridine, 2,6-dichloro-4-(trifluoromethyl)-;2,6-Dichloro-4-(trifluoromethyl)pyridine ISO 9001:2015 REACH | | CAS: | 39890-98-7 | | MF: | C6H2Cl2F3N | | MW: | 215.99 | | EINECS: | 201-525-2 | | Product Categories: | Fluorine series;Pyridines;Aromatics;Heterocycles;Intermediates;Chemical Synthesis;Halogenated Heterocycles;Heterocyclic Building BlocksHeterocyclic Building Blocks;New Products for Chemical Synthesis | | Mol File: | 39890-98-7.mol |  |
| | 2,6-Dichloro-4-(trifluoromethyl)pyridine Chemical Properties |
| Boiling point | 85°C 40mm | | density | 1.505 g/mL at 25 °C | | refractive index | n20/D 1.473 | | Fp | 70-75°C/25mm | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | form | clear liquid | | pka | -4.51±0.10(Predicted) | | color | Colorless to Light yellow | | InChI | InChI=1S/C6H2Cl2F3N/c7-4-1-3(6(9,10)11)2-5(8)12-4/h1-2H | | InChIKey | KVNQWVYYVLCZKK-UHFFFAOYSA-N | | SMILES | C1(Cl)=NC(Cl)=CC(C(F)(F)F)=C1 | | CAS DataBase Reference | 39890-98-7(CAS DataBase Reference) |
| Hazard Codes | T,F,Xi | | Risk Statements | 36/37/38-25 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN2810 | | WGK Germany | 3 | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 2933399990 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 2,6-Dichloro-4-(trifluoromethyl)pyridine Usage And Synthesis |
| Chemical Properties | Colorless liquid | | Uses | 2,6-Dichloro-4-(trifluoromethyl)pyridine is a tri-substituted pyridine used in the preparation of pharmaceuticals agents with antitumor activities. |
| | 2,6-Dichloro-4-(trifluoromethyl)pyridine Preparation Products And Raw materials |
|