| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
EPhos Pd G4 manufacturers
- EPhos Pd G4
-
- $2.00
-
2026-08-25
- CAS:2132978-44-8
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 100kg
- Ephos Pd G4
-
-
2025-12-23
- CAS:2132978-44-8
- Min. Order: 1g
- Purity: 98%
- Supply Ability: 500g
|
| | EPhos Pd G4 Basic information |
| Product Name: | EPhos Pd G4 | | Synonyms: | EPhos Pd G4;Methanesulfonato{Dicyclohexyl[3-(1-methylethoxy)-2',4',6'-tris(1-methylethyl)-1,1'-biphenyl-2-yl]phosphine}(2'-methylamino-1,1'-biphenyl-2-yl)palladium(II)
(Ephos Pd G4);EPhos Catalyst;Methanesulfonato{Dicyclohexyl[3-(1-methylethoxy)-2',4',6'-tris(1-methylethyl)-1,1'-biphenyl-2-yl]phosphine}(2'-methylamino-1,1'-biphenyl-2-yl)palladium(II);dicyclohexyl-[2-isopropoxy-6-(2,4,6-triisopropylphenyl)phenyl]phosphane (N-methyl-2-phenyl-anilino)-methylsulfonyloxy-palladium;Methanesulfonicacid{bicyclohexyl(3-isopropoxy-2',4′,6′-triisopropyl-[1,1′-biphenyl]-2-yl)phosphane}(2'-methylamino-1,1'-biphenyl-2-yl)palladium(II),EphosPdG4;Dicyclohexyl[3-(1-methylethoxy)-2′,4′,6′-tri(1-methylethyl)[1,1′-biphenyl]-2-yl]phosphine-κP](methanesulfonate-κO)[2′-(methylamino-κN)[1,1′-biphenyl]-2-yl-κC]palladium;Dicyclohexyl[3-(1-methylethoxy)-2′,4′,6′-tris(1-methylethyl)[1,1′-biphenyl]-2-yl]phosphine-κP](methanesulfonato-κO)[2′-(methylamino-κN)[1,1′-biphenyl]-2-yl-κC]palladium | | CAS: | 2132978-44-8 | | MF: | C50H70NO4PPdS | | MW: | 918.55 | | EINECS: | | | Product Categories: | | | Mol File: | 2132978-44-8.mol |  |
| | EPhos Pd G4 Chemical Properties |
| storage temp. | 2-8°C, protect from light | | form | powder or crystals | | Appearance | Brown to dark brown Solid | | InChIKey | HFYQPKNKOSULDB-UHFFFAOYSA-M | | SMILES | [Pd+]c5c(cccc5)c6c(cccc6)NC.P(C4CCCCC4)(C3CCCCC3)c1c(cccc1c2c(cc(cc2C(C)C)C(C)C)C(C)C)OC(C)C.[S](=O)(=O)([O-])C |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | EPhos Pd G4 Usage And Synthesis |
| Uses | Buchwald palladacycle precatalyst with EPhos ligand for Pd-catalyzed C–N cross-coupling between primary amines and aryl halides to form 2-arylaminooxazoles. Catalyst system was reported with NaOPh (CDS001581).
It is a fourth generation (G4) Buchwald precatalyst that is similar to the third generation (G3) precatalysts except that the amino group on the biphenyl backbone is methylated. This modification helps to prevent the limitations of using the third generation precatalysts. It is air, moisture and thermally-stable and shows good solubility in common organic solvents. BrettPhos Pd G4 is highly useful in cross-coupling reactions. Some of its excellent features include lower catalyst loadings, shorter reaction time, and efficient formation of the active catalytic species and accurate control of ligand: palladium ratio. | | reaction suitability | reaction type: Buchwald-Hartwig Cross Coupling Reaction
reaction type: Heck Reaction
reaction type: Hiyama Coupling
reaction type: Negishi Coupling
reaction type: Sonogashira Coupling
reaction type: Stille Coupling
reaction type: Suzuki-Miyaura Coupling
reagent type: catalyst
reaction type: Cross Couplings |
| | EPhos Pd G4 Preparation Products And Raw materials |
|