| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | RockPhos Pd G3 Basic information | | Reaction |
| Product Name: | RockPhos Pd G3 | | Synonyms: | METHANESULFONATO(2-(DI-T-BUTYLPHOSPHINO)-3-METHOXY-6-METHYL-2',4',6'-TRI-I-PROPYL-1,1'-BIPHENYL)(2'-AMINO-1,1'-BIPHENYL-2-YL)PALLADIUM(II),MIN.98%[ROCKPHOSPALLADACYCLEGEN.3];Methanesulfonato[2-(di-t-butylphosphino)-3-methoxy-6-methyl-2’,4’,6’-tri-i-propylbiphenyl](2’-amino-2-biphenylyl)palladium(II);2'-(Amino-κN)[1,1'-biphenyl]-2-yl-κC][bis(1,1-dimethylethyl)[3-methoxy-6-methyl-2',4',6'-tris(1-methylethyl)[1,1'-biphenyl]-2-yl]phosphine-κP](methanesulfonato-κO)palladium;Methanesulfonato(2-(di-t-butylphosphino)-3-methoxy-6-methyl-2',4',6'-tri-i-propyl-1,1'-biphenyl)(2'-amino-1,1'-biphenyl-2-yl)palladium(II)
(RockPhos Pd G3);RockPhos Pd G3;Methanesulfonato(2-(di-t-butylphosphino)-3-methoxy-6-methyl-2'',4'',6''-tri-i-propyl-1,1''-biphenyl)(2''-amino-1,1''-biphenyl-2-yl)palladium(II);RockPhos Pd G3 ChemBeads;Methanesulfonato(2-(di-t-butylphosphino)-3-methoxy-6-methyl-2',4',6'-tri-i-propyl-1,1'-biphenyl)(2'-amino-1,1'-biphenyl-2-yl)palladium(II), min. 98% [RockPhos Palladacycle Gen. 3] | | CAS: | 2009020-38-4 | | MF: | C44H63NO4PPdS- | | MW: | 839.434081 | | EINECS: | | | Product Categories: | | | Mol File: | 2009020-38-4.mol |  |
| | RockPhos Pd G3 Chemical Properties |
| Melting point | 220-250 °C | | storage temp. | 2-8°C, protect from light, stored under nitrogen | | form | Powder | | color | brown | | InChIKey | QAHMIRGGAFFMDS-UHFFFAOYSA-N | | SMILES | CC1=CC=C(OC)C(P(C(C)(C)C)C(C)(C)C)=C1C2=C(C(C)C)C=C(C(C)C)C=C2C(C)C.NC3=CC=CC=C3C4=CC=CC=C4[Pd]OS(C)(=O)=O | | CAS DataBase Reference | 2009020-38-4 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | RockPhos Pd G3 Usage And Synthesis |
| Reaction |
- Palladium precatalyst used for the arylation of an aliphatic alcohol.
- Palladium precatalyst used for the synthesis of diaryl ethers under mild conditions.
- Palladium precatalyst used for the intermolecular C-O bond formation with secondary and primary alcohols.
| | Uses | Buchwald 3rd Generation Pd Precatalyst containing bulk RockPhos ligand. This system has been shown to be effective for cross-coupling reactions like the arylation of aliphatic alcohols.
Synthesis and Application of Palladium Precatalysts that Accommodate Extremely Bulky Di-tert-butylphosphino Biaryl Ligands | | reaction suitability | reaction type: Buchwald-Hartwig Cross Coupling Reaction
reaction type: Cross Couplings
reaction type: Heck Reaction
reaction type: Hiyama Coupling
reaction type: Negishi Coupling
reaction type: Sonogashira Coupling
reaction type: Stille Coupling
reaction type: Suzuki-Miyaura Coupling
reagent type: catalyst |
| | RockPhos Pd G3 Preparation Products And Raw materials |
|