| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
LaaJoo |
| Tel: |
021-60702684 18516024827 |
| Email: |
huang.jiayi@sinocompound.com |
VPhos Pd G4 manufacturers
- VPhos Pd G4
-
- $2.00
-
2026-08-25
- CAS:1848244-57-4
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 100kg
- VPhos Pd G4
-
-
2025-12-23
- CAS:1848244-57-4
- Min. Order: 1g
- Purity: 98%
- Supply Ability: 500
|
| | VPhos Pd G4 Basic information |
| Product Name: | VPhos Pd G4 | | Synonyms: | VPhos Pd G4;Methanesulfonato(2- dicyclohexyl phosphine-2'-methoxy-4',6'-di-t-butylphosphino-1,1'-diphenyl) (2'-methylamino-1,1'-biphenyl-2-yl)palladium(II);Methanesulfonato(2- dicyclohexyl phosphine-2'-methoxy-4',6'-di-t-butylphosphino-1,1'-diphenyl) (2'-methylamino-1,1'-biphenyl-2-yl)palladium(II)
(VPhos Pd G4);Methanesulfonicacid{2-dicyclohexylphosphino-2'-methoxy-4',6'-di-tert-butyl-1,1'-biphenyl}(2'-methylamino-1,1'-biphenyl-2-yl)palladium(II),VPhosPdG4;Methanesulfonato(2- dicyclohexyl phosphine-2'-methoxy-4',6'-di-t-butylphosphino-1,1'-diphenyl) (2'-methylamino-1,1'-biphenyl-2-yl)palladium(II) (VPhos Pd G4) | | CAS: | 1848244-57-4 | | MF: | C47H64NO4PPdS | | MW: | 876.47 | | EINECS: | | | Product Categories: | | | Mol File: | 1848244-57-4.mol |  |
| | VPhos Pd G4 Chemical Properties |
| Melting point | 160-162 °C | | form | powder or crystals | | InChIKey | VAPBXRPNLXSRPD-UHFFFAOYSA-N | | SMILES | P(C1CCCCC1)(C1CCCCC1)(C1C=CC=CC=1C1C(=CC(C(C)(C)C)=CC=1C(C)(C)C)OC)[Pd+2]1(N(C2=CC=CC=C2C2=CC=CC=[C-]12)C)[O-]S(=O)(=O)C |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | VPhos Pd G4 Usage And Synthesis |
| Uses | Buchwald palladacycle precatalyst with new biaryl(dialkyl)phosphine ligand, VPhos, has an improved activity profile for the reductive coupling of non-aromatic heterocyclic alkyl bromides. Its combined use with a surfactant system of octanoic acid/sodium octanoate enables Negishi coupling and access to diverse C(sp3)–C(sp2) cross-coupled products.
It is a fourth-generation (G4) Buchwald precatalysts are similar to the third generation (G3) precatalysts except that the amino group on the biphenyl backbone is methylated. This modification helps to prevent the limitations of using the third generation precatalysts. It is air-, moisture-, and thermally stable and shows good solubility in common organic solvents. | | reaction suitability | reaction type: Buchwald-Hartwig Cross Coupling Reaction
reaction type: Heck Reaction
reaction type: Hiyama Coupling
reaction type: Negishi Coupling
reaction type: Sonogashira Coupling
reaction type: Stille Coupling
reaction type: Suzuki-Miyaura Coupling
reagent type: catalyst
reaction type: Cross Couplings |
| | VPhos Pd G4 Preparation Products And Raw materials |
|