|
|
| | 2-Hydroxy-5-nitro-3-(trifluoromethyl)pyridine Basic information | | Preparation |
| Product Name: | 2-Hydroxy-5-nitro-3-(trifluoromethyl)pyridine | | Synonyms: | 5-nitro-3-trifluoromethyl-2-hydroxypyridine;5-NITRO-3-(TRIFLUOROMETHYL-2-PYRIDONE);2-Hydroxy-5-nitro-3-(trifluoromethyl)pyridine 98%;2-Hydroxy-5-nitro-3-(trifluoromethyl)pyridine98%;5-Nitro-3-(trifluoromethyl)pyridin-2-ol, 5-Nitro-3-(trifluoromethyl)pyridin-2(1H)-one;5-Nitro-3-(trifluoromethyl)pyridin-2-one;5-aMino-3-(trifluoroMethyl)pyridin-2(1H)-one;5-Nitro-3-trifluoroMethyl-1H-pyridin-2-one | | CAS: | 99368-66-8 | | MF: | C6H3F3N2O3 | | MW: | 208.09 | | EINECS: | 848-721-7 | | Product Categories: | Fluorine series;Pyridines;Pyridine | | Mol File: | 99368-66-8.mol |  |
| | 2-Hydroxy-5-nitro-3-(trifluoromethyl)pyridine Chemical Properties |
| Melting point | 158°C | | Boiling point | 255.2±40.0 °C(Predicted) | | density | 1.61±0.1 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | form | solid | | pka | 5.71±0.10(Predicted) | | color | Yellow | | InChI | InChI=1S/C6H3F3N2O3/c7-6(8,9)4-1-3(11(13)14)2-10-5(4)12/h1-2H,(H,10,12) | | InChIKey | BHUILUYFGJBXHQ-UHFFFAOYSA-N | | SMILES | C1(=O)NC=C([N+]([O-])=O)C=C1C(F)(F)F | | LogP | 0.41 at 25℃ | | CAS DataBase Reference | 99368-66-8(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39 | | Hazard Note | Irritant | | HS Code | 2933399990 |
| | 2-Hydroxy-5-nitro-3-(trifluoromethyl)pyridine Usage And Synthesis |
| Preparation | Nitric acid (24 mL, 0.55 mol) was slowly added dropwise to a solution of 2-hydroxy-3-(trifluoromethyl)pyridine (20.00 g, 0.12 mol) in 160 mL of sulfuric acid at -10 °C, and the reaction mixture was stirred at 40 °C for 6 hours. The progress of the reaction was then confirmed by TLC. After the reaction was complete, the reaction mixture was added to ice water, and the pH of the solution was adjusted to 4-5 with saturated NaOH aqueous solution. The aqueous layer was extracted with ethyl acetate, and the resulting organic layer was washed with saturated brine, dried over anhydrous sodium sulfate, filtered, and concentrated under reduced pressure to obtain 2-hydroxy-5-nitro-3-trifluoromethylpyridine. | | Chemical Properties | 2-Hydroxy-5-nitro-3-trifluoromethylpyridine is solid at room temperature and pressure, and it is a pyridine derivative. The hydroxyl group in the 2nd position in the structure and the double bond on the pyridine ring form the enol form that will be reciprocally isomorphic into the structure of amide. | | Uses | 2-Hydroxy-5-nitro-3-(trifluoromethyl)pyridine is a class of aromatic heterocyclic compounds that can be used as intermediates for Apalutamide, which is an androgen receptor inhibitor used in the treatment of prostate cancer. |
| | 2-Hydroxy-5-nitro-3-(trifluoromethyl)pyridine Preparation Products And Raw materials |
|