|
|
| | Diazald(R)-N-methyl-d3 Basic information |
| Product Name: | Diazald(R)-N-methyl-d3 | | Synonyms: | N-METHYL-D3-N-NITROSO-P-TOLUENESULFONAMIDE;N-METHYL-N-NITROSO-P-TOLUENESULFONAMIDE (N-METHYL-D3);Diazald?N-methyl-d3;diazald-N-methyl-D3;DIAZALD-N-METHYL-D3, 98 ATOM % D;(Diazomethane D2 precursor);Diazald-d3;N-Methyl-N-nitrosotoluene-4-sulfonamide-d3 | | CAS: | 42366-72-3 | | MF: | C8H7D3N2O3S | | MW: | 217.26 | | EINECS: | | | Product Categories: | Alphabetical Listings;D;Stable Isotopes | | Mol File: | 42366-72-3.mol |  |
| | Diazald(R)-N-methyl-d3 Chemical Properties |
| Melting point | 60-63 °C(lit.) | | storage temp. | 0-6°C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | color | Pale Yellow to Light Yellow | | InChI | 1S/C8H10N2O3S/c1-7-3-5-8(6-4-7)14(12,13)10(2)9-11/h3-6H,1-2H3/i2D3 | | InChIKey | FFKZOUIEAHOBHW-BMSJAHLVSA-N | | SMILES | [2H]C([2H])([2H])N(N=O)S(=O)(=O)c1ccc(C)cc1 |
| Hazard Codes | Xn,Xi,E | | Risk Statements | 20/21/22-43-36/37/38-2 | | Safety Statements | 26-36-36/37-35-15 | | RIDADR | UN3234 - UN3224 DOT class 4.1 (N-Methyl-N-nitroso-p-methylbenzenesulfonamide) Self-reactive solid type C, temperature controlled) | | WGK Germany | 2 | | Storage Class | 4.1A - Other explosive hazardous materials | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
Skin Sens. 1
STOT SE 3 |
| | Diazald(R)-N-methyl-d3 Usage And Synthesis |
| Uses | N-Methyl-d3-N-nitroso-p-toluenesulfonamide is the labeled version of Diazald |
| | Diazald(R)-N-methyl-d3 Preparation Products And Raw materials |
|