| Company Name: |
Ascent Scientific |
| Tel: |
4401179829988 |
| Email: |
customerservice@ascentscientific.co.uk |
H-Ser-Leu-Ile-Gly-Arg-Leu-NH2 manufacturers
- SLIGRL-NH2
-
- $99.00
-
2026-08-14
- CAS:171436-38-7
- Purity: 99.86%
- Supply Ability: 10g
|
| | H-Ser-Leu-Ile-Gly-Arg-Leu-NH2 Basic information |
| Product Name: | H-Ser-Leu-Ile-Gly-Arg-Leu-NH2 | | Synonyms: | COAGULATION FACTOR II RECEPTOR-LIKE 1 (1-6) AMIDE (MOUSE, RAT);H2N-SLIGRL-AMIDE;Ser-Leu-Ile-Gly-Arg-Leu-NH2;SLIGRL-NH2 Protease-Activated Receptor 2 (PAR2) Agonist;PAR2-AP, SLIGRL-NH2;Ser-Leu-Ile-Gly-Arg-Leu-amide trifluoroacetate salt;ThroMbin Receptor-Like 1 (1-6) aMide (Mouse, rat), SLIGRLaMide, Proteinase Activated Receptor 2 (1-6) aMide (Mouse, rat), Coagulation Factor II Receptor-Like 1 (1-6) aMide (Mouse, rat);PAR-2 Agonist Peptide aMide (SLIGRL-NH2), Mouse | | CAS: | 171436-38-7 | | MF: | C29H56N10O7 | | MW: | 656.82 | | EINECS: | | | Product Categories: | Proteinase-activated receptor (PAR);Peptide Receptors;peptide | | Mol File: | 171436-38-7.mol |  |
| | H-Ser-Leu-Ile-Gly-Arg-Leu-NH2 Chemical Properties |
| density | 1.34±0.1 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | DMSO (Slightly), Methanol (Slightly), Water (Slightly) | | form | solid | | pka | 12.04±0.10(Predicted) | | color | White to off-white | | Water Solubility | Soluble to 1 mg/ml in water | | Sequence | Ser-Leu-Ile-Gly-Arg-Leu-NH2 | | InChIKey | SGPMJRPYYIJZPC-JYAZKYGWSA-N | | SMILES | CC[C@H](C)[C@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](N)CO)C(=O)NCC(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CC(C)C)C(N)=O |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | H-Ser-Leu-Ile-Gly-Arg-Leu-NH2 Usage And Synthesis |
| Uses | SLIGRL-NH2 is a PAR-2 activating peptide. | | Biochem/physiol Actions | Selective proteinase-activated receptor 2 (PAR2) peptide agonist. | | storage | -20°C |
| | H-Ser-Leu-Ile-Gly-Arg-Leu-NH2 Preparation Products And Raw materials |
|