| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
- 1,5-Hexanediol
-
- $1500.00
-
2025-04-08
- CAS:928-40-5
- Min. Order: 1g
- Purity: 98
- Supply Ability: 5000 Kg
|
| | 1,5-Hexanediol Basic information |
| | 1,5-Hexanediol Chemical Properties |
| Melting point | 26.38°C (estimate) | | Boiling point | 89-91 °C/0.5 mmHg (lit.) | | density | 0.981 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.451(lit.) | | Fp | >230 °F | | storage temp. | Store at room temperature | | solubility | Chloroform; Dichloromethane; Ethyl Acetate; Methanol | | pka | 15.16±0.10(Predicted) | | form | Colourless Liquid | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C6H14O2/c1-6(8)4-2-3-5-7/h6-8H,2-5H2,1H3 | | InChIKey | UNVGBIALRHLALK-UHFFFAOYSA-N | | SMILES | C(O)CCCC(O)C | | Surface tension | 34.1mN/m at 293.15K |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 2 | | RTECS | MO2080000 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 1,5-Hexanediol Usage And Synthesis |
| Uses | Hexane-2,6-diol is an intermediate in the synthesis of (R)-cis-5ξ-Methyl Atracurium Dibesylate (M288320), which is a derivative of Atracurium (A794500) Dibesylate which displays neuromuscular blocking activity. | | Definition | ChEBI: 1,5-Hexanediol is an aliphatic alcohol. | | General Description | Surface tension and binding constants were studied for 1,5-hexanediol. |
| | 1,5-Hexanediol Preparation Products And Raw materials |
|