| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 1,6-Hexanediol dimethacrylate Basic information |
| Product Name: | 1,6-Hexanediol dimethacrylate | | Synonyms: | 2-Propenoicacid,2-methyl-,1,6-hexanediylester;1,6-HEXANEDIOL DIMETHACRYLATE;1,6-HEXAMETHYLENE DIMETHACRYLATE;1,6-hexanediyl bismethacrylate;1,6-Hexanediol dimethacrylate, stabilized, 95%;1,6-Hexandiylbismethacrylat;1,6-HEXAMETHYLENE DIMETHACRYLATE (1,6-HEXANEDIOL DIMETHACRYLATE);1,6-Hexanediyl bis(2-methylacrylate) | | CAS: | 6606-59-3 | | MF: | C14H22O4 | | MW: | 254.32 | | EINECS: | 229-551-7 | | Product Categories: | monomer;C12 to C63Monomers;Acrylic Monomers;Carbonyl Compounds;Esters;Polyfunctional Acrylics | | Mol File: | 6606-59-3.mol |  |
| | 1,6-Hexanediol dimethacrylate Chemical Properties |
| Melting point | <25 °C | | Boiling point | >315 °C (lit.) | | density | 0.995 g/mL at 25 °C (lit.) | | vapor pressure | 0.02 mm Hg ( 100 °C) | | refractive index | n20/D 1.458(lit.) | | Fp | >230 °F | | storage temp. | Amber Vial, Refrigerator | | solubility | Chloroform (Sparingly), Methanol (Slightly) | | form | Oil | | color | Colourless | | Specific Gravity | 1.0020.995 | | Water Solubility | 23mg/L at 20℃ | | BRN | 1957290 | | Stability: | Light Sensitive | | Cosmetics Ingredients Functions | NAIL CONDITIONING | | InChI | 1S/C14H22O4/c1-11(2)13(15)17-9-7-5-6-8-10-18-14(16)12(3)4/h1,3,5-10H2,2,4H3 | | InChIKey | SAPGBCWOQLHKKZ-UHFFFAOYSA-N | | SMILES | CC(=C)C(=O)OCCCCCCOC(=O)C(C)=C | | LogP | 4.08 at 20℃ | | CAS DataBase Reference | 6606-59-3(CAS DataBase Reference) | | EPA Substance Registry System | 1,6-Hexanediol dimethacrylate (6606-59-3) |
| Hazard Codes | Xn,Xi | | Risk Statements | 20/21/22-36/37/38 | | Safety Statements | 26-36-37/39-24/25 | | RIDADR | UN 3082 9/PG 3 | | WGK Germany | 2 | | F | 8-10-13-23 | | TSCA | TSCA listed | | HS Code | 29161290 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 1,6-Hexanediol dimethacrylate Usage And Synthesis |
| Chemical Properties | CLEAR LIQUID | | Uses | 1,6-Hexanediol Dimethacrylate is used in preparation of sheet-shaped molding compound raw material and product for automotive field. |
| | 1,6-Hexanediol dimethacrylate Preparation Products And Raw materials |
|