- Cucurbitacin A
-
- $0.00 / 5mg
-
2023-02-24
- CAS:6040-19-3
- Min. Order: 5mg
- Purity: ≥98%(HPLC)
- Supply Ability: 10 g
|
| | Cucurbitacin A Basic information |
| Product Name: | Cucurbitacin A | | Synonyms: | Cucurbitacin A;(10α,23E)-25-(Acetyloxy)-2β,16α,20-trihydroxy-9β-(hydroxymethyl)-19-norlanosta-5,23-diene-3,11,22-trione;2,16,20,25-Tetrahydroxy-9-(hydroxymethyl)-19-norlanosta-5,23-diene-3,11,22-trione 25-acetate;Cucurbitacine A;NSC 94743;Cucurbit A;(2S,4R,9beta,16alpha,23E)-2,16,20-trihydroxy-9-(hydroxymethyl)-10,14-dimethyl-1,11,22-trioxo-4,9-cyclo-9,10-secocholesta-5,23-dien-25-yl acetate;19-Norlanosta-5,23-diene-3,11,22-trione, 25-(acetyloxy)-2,16,20-trihydroxy-9-(hydroxymethyl)-, (2β,9β,10α,16α,23E)- | | CAS: | 6040-19-3 | | MF: | C32H46O9 | | MW: | 574.7 | | EINECS: | | | Product Categories: | | | Mol File: | 6040-19-3.mol |  |
| | Cucurbitacin A Chemical Properties |
| Melting point | 207-208 °C | | Boiling point | 731.0±60.0 °C(Predicted) | | density | 1.27±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 12.60±0.29(Predicted) | | form | solid | | InChIKey | IHTCCHVMPGDDSL-IVNGUWCNSA-N | | SMILES | O[C@H]1[C@@H]([C@@]2([C@]([C@H]3[C@]([C@@H]4C[C@@H](C(=O)C(C4=CC3)(C)C)O)(C(=O)C2)CO)(C1)C)C)[C@](O)(C)C(=O)\C=C\C(OC(=O)C)(C)C | | CAS DataBase Reference | 6040-19-3 |
| WGK Germany | WGK 3 | | Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2
very toxic hazardous materials | | Hazard Classifications | Acute Tox. 2 Oral |
| | Cucurbitacin A Usage And Synthesis |
| Uses | Cucurbitacin A, a triterpenoid that could be isolated from the Stems of Cucumis melo, shows anti-cancer activity[1]. | | Definition | ChEBI: Cucurbitacin A is a cucurbitacin. | | Hazard | A poison. | | References | [1] Chuan Chen, et al. Cucurbitane-type triterpenoids from the stems of Cucumis melo. J Nat Prod. 2009 May 22;72(5):824-9. DOI:10.1021/np800692t |
| | Cucurbitacin A Preparation Products And Raw materials |
|